C29H29F2N7O5 — CID 160911436
(Z)-1-(3,3-difluoroazetidin-1-yl)-3-[3-(3-methoxy-5-methylphenyl)-1,2,4-triazol-1-yl]prop-2-en-1-one;(Z)-3-[3-(3-methoxy-5-methylphenyl)-1,2,4-triazol-1-yl]prop-2-enoic acid (PubChem CID 160911436) has the molecular formula C29H29F2N7O5 and a molecular weight of 593.59 g/mol. Its IUPAC name is (Z)-1-(3,3-difluoroazetidin-1-yl)-3-[3-(3-methoxy-5-methylphenyl)-1,2,4-triazol-1-yl]prop-2-en-1-one;(Z)-3-[3-(3-methoxy-5-methylphenyl)-1,2,4-triazol-1-yl]prop-2-enoic acid.
| Compound Name | (Z)-1-(3,3-difluoroazetidin-1-yl)-3-[3-(3-methoxy-5-methylphenyl)-1,2,4-triazol-1-yl]prop-2-en-1-one;(Z)-3-[3-(3-methoxy-5-methylphenyl)-1,2,4-triazol-1-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 160911436 |
| Molecular Formula | C29H29F2N7O5 |
| Molecular Weight | 593.59 g/mol |
| Exact Mass | 593.22 |
| IUPAC Name | (Z)-1-(3,3-difluoroazetidin-1-yl)-3-[3-(3-methoxy-5-methylphenyl)-1,2,4-triazol-1-yl]prop-2-en-1-one;(Z)-3-[3-(3-methoxy-5-methylphenyl)-1,2,4-triazol-1-yl]prop-2-enoic acid |
| SMILES | COc1cc(C)cc(-c2ncn(/C=C\C(=O)N3CC(F)(F)C3)n2)c1.COc1cc(C)cc(-c2ncn(/C=C\C(=O)O)n2)c1 |
| InChI | InChI=1S/C16H16F2N4O2.C13H13N3O3/c1-11-5-12(7-13(6-11)24-2)15-19-10-22(20-15)4-3-14(23)21-8-16(17,18)9-21;1-9-5-10(7-11(6-9)19-2)13-14-8-16(15-13)4-3-12(17)18/h3-7,10H,8-9H2,1-2H3;3-8H,1-2H3,(H,17,18)/b2*4-3- |
| InChIKey | SQVJSKKKGSYCAN-CHNJZELVSA-N |
| XLogP | 4.03 |
| TPSA | 137.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.59 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|