C29H27FN8O2 — CID 160911548
(Z)-3-fluoro-4-(1-methylpyrrolidin-2-yl)-1-[4-[3-methyl-4-([1,2,4]triazolo[4,3-c]pyrimidin-7-yloxy)anilino]quinazolin-6-yl]but-3-en-2-one (PubChem CID 160911548) has the molecular formula C29H27FN8O2 and a molecular weight of 538.59 g/mol. Its IUPAC name is (Z)-3-fluoro-4-(1-methylpyrrolidin-2-yl)-1-[4-[3-methyl-4-([1,2,4]triazolo[4,3-c]pyrimidin-7-yloxy)anilino]quinazolin-6-yl]but-3-en-2-one.
| Compound Name | (Z)-3-fluoro-4-(1-methylpyrrolidin-2-yl)-1-[4-[3-methyl-4-([1,2,4]triazolo[4,3-c]pyrimidin-7-yloxy)anilino]quinazolin-6-yl]but-3-en-2-one |
|---|---|
| PubChem CID | 160911548 |
| Molecular Formula | C29H27FN8O2 |
| Molecular Weight | 538.59 g/mol |
| Exact Mass | 538.22 |
| IUPAC Name | (Z)-3-fluoro-4-(1-methylpyrrolidin-2-yl)-1-[4-[3-methyl-4-([1,2,4]triazolo[4,3-c]pyrimidin-7-yloxy)anilino]quinazolin-6-yl]but-3-en-2-one |
| SMILES | Cc1cc(Nc2ncnc3ccc(CC(=O)/C(F)=C/C4CCCN4C)cc23)ccc1Oc1cc2nncn2cn1 |
| InChI | InChI=1S/C29H27FN8O2/c1-18-10-20(6-8-26(18)40-28-14-27-36-34-17-38(27)16-33-28)35-29-22-11-19(5-7-24(22)31-15-32-29)12-25(39)23(30)13-21-4-3-9-37(21)2/h5-8,10-11,13-17,21H,3-4,9,12H2,1-2H3,(H,31,32,35)/b23-13- |
| InChIKey | SQVUHAWGKKANQA-QRVIBDJDSA-N |
| XLogP | 4.97 |
| TPSA | 110.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.59 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|