C77H76 — CID 160911611
1-propan-2-ylanthracene;2-propan-2-ylanthracene;9-propan-2-ylanthracene;1-propan-2-ylnaphthalene;2-propan-2-ylnaphthalene (PubChem CID 160911611) has the molecular formula C77H76 and a molecular weight of 1001.46 g/mol. Its IUPAC name is 1-propan-2-ylanthracene;2-propan-2-ylanthracene;9-propan-2-ylanthracene;1-propan-2-ylnaphthalene;2-propan-2-ylnaphthalene.
| Compound Name | 1-propan-2-ylanthracene;2-propan-2-ylanthracene;9-propan-2-ylanthracene;1-propan-2-ylnaphthalene;2-propan-2-ylnaphthalene |
|---|---|
| PubChem CID | 160911611 |
| Molecular Formula | C77H76 |
| Molecular Weight | 1001.46 g/mol |
| Exact Mass | 1000.59 |
| IUPAC Name | 1-propan-2-ylanthracene;2-propan-2-ylanthracene;9-propan-2-ylanthracene;1-propan-2-ylnaphthalene;2-propan-2-ylnaphthalene |
| SMILES | CC(C)c1c2ccccc2cc2ccccc12.CC(C)c1ccc2cc3ccccc3cc2c1.CC(C)c1ccc2ccccc2c1.CC(C)c1cccc2cc3ccccc3cc12.CC(C)c1cccc2ccccc12 |
| InChI | InChI=1S/3C17H16.2C13H14/c1-12(2)17-15-9-5-3-7-13(15)11-14-8-4-6-10-16(14)17;1-12(2)16-9-5-8-15-10-13-6-3-4-7-14(13)11-17(15)16;1-12(2)13-7-8-16-10-14-5-3-4-6-15(14)11-17(16)9-13;1-10(2)12-9-5-7-11-6-3-4-8-13(11)12;1-10(2)12-8-7-11-5-3-4-6-13(11)9-12/h3*3-12H,1-2H3;2*3-10H,1-2H3 |
| InChIKey | SQWADLRYYSVCOC-UHFFFAOYSA-N |
| XLogP | 23.28 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 77 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1001.46 |
| LogP ≤ 5 | 23.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|