About 3-propan-2-yl-4H-1,2,4-oxadiazol-5-one
3-propan-2-yl-4H-1,2,4-oxadiazol-5-one (PubChem CID 160912900) has the molecular formula C15H24N6O6
and a molecular weight of 384.39 g/mol. Its IUPAC name is 3-propan-2-yl-4H-1,2,4-oxadiazol-5-one.
Molecular Properties
| Compound Name | 3-propan-2-yl-4H-1,2,4-oxadiazol-5-one |
| PubChem CID | 160912900 |
| Molecular Formula | C15H24N6O6 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | 3-propan-2-yl-4H-1,2,4-oxadiazol-5-one |
| SMILES | CC(C)c1noc(=O)[nH]1.CC(C)c1noc(=O)[nH]1.CC(C)c1noc(=O)[nH]1 |
| InChI | InChI=1S/3C5H8N2O2/c3*1-3(2)4-6-5(8)9-7-4/h3*3H,1-2H3,(H,6,7,8) |
| InChIKey | SRAFFPNUZGVMQA-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 176.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze 3-propan-2-yl-4H-1,2,4-oxadiazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propan-2-yl-4H-1,2,4-oxadiazol-5-one?
The IUPAC name of 3-propan-2-yl-4H-1,2,4-oxadiazol-5-one (CID 160912900) is 3-propan-2-yl-4H-1,2,4-oxadiazol-5-one.
What is the SMILES notation for 3-propan-2-yl-4H-1,2,4-oxadiazol-5-one?
The canonical SMILES for 3-propan-2-yl-4H-1,2,4-oxadiazol-5-one is CC(C)c1noc(=O)[nH]1.CC(C)c1noc(=O)[nH]1.CC(C)c1noc(=O)[nH]1.
What is the InChIKey of 3-propan-2-yl-4H-1,2,4-oxadiazol-5-one?
The InChIKey is SRAFFPNUZGVMQA-UHFFFAOYSA-N. The full InChI is InChI=1S/3C5H8N2O2/c3*1-3(2)4-6-5(8)9-7-4/h3*3H,1-2H3,(H,6,7,8).
What are the key properties of 3-propan-2-yl-4H-1,2,4-oxadiazol-5-one?
3-propan-2-yl-4H-1,2,4-oxadiazol-5-one has a molecular weight of 384.39 g/mol, XLogP of 1.46, 3 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propan-2-yl-4H-1,2,4-oxadiazol-5-one is sourced from PubChem (CID 160912900), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).