About ethyl 2-fluoro-6H-thieno[2,3-b]pyrrole-5-carboxylate;5-fluorothiophene-3-carbaldehyde
ethyl 2-fluoro-6H-thieno[2,3-b]pyrrole-5-carboxylate;5-fluorothiophene-3-carbaldehyde (PubChem CID 160915892) has the molecular formula C14H11F2NO3S2
and a molecular weight of 343.38 g/mol. Its IUPAC name is ethyl 2-fluoro-6H-thieno[2,3-b]pyrrole-5-carboxylate;5-fluorothiophene-3-carbaldehyde.
Molecular Properties
| Compound Name | ethyl 2-fluoro-6H-thieno[2,3-b]pyrrole-5-carboxylate;5-fluorothiophene-3-carbaldehyde |
| PubChem CID | 160915892 |
| Molecular Formula | C14H11F2NO3S2 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.01 |
| IUPAC Name | ethyl 2-fluoro-6H-thieno[2,3-b]pyrrole-5-carboxylate;5-fluorothiophene-3-carbaldehyde |
| SMILES | CCOC(=O)c1cc2cc(F)sc2[nH]1.O=Cc1csc(F)c1 |
| InChI | InChI=1S/C9H8FNO2S.C5H3FOS/c1-2-13-9(12)6-3-5-4-7(10)14-8(5)11-6;6-5-1-4(2-7)3-8-5/h3-4,11H,2H2,1H3;1-3H |
| InChIKey | SRJYBZPXEMTLBE-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-fluoro-6H-thieno[2,3-b]pyrrole-5-carboxylate;5-fluorothiophene-3-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-fluoro-6H-thieno[2,3-b]pyrrole-5-carboxylate;5-fluorothiophene-3-carbaldehyde?
The IUPAC name of ethyl 2-fluoro-6H-thieno[2,3-b]pyrrole-5-carboxylate;5-fluorothiophene-3-carbaldehyde (CID 160915892) is ethyl 2-fluoro-6H-thieno[2,3-b]pyrrole-5-carboxylate;5-fluorothiophene-3-carbaldehyde.
What is the SMILES notation for ethyl 2-fluoro-6H-thieno[2,3-b]pyrrole-5-carboxylate;5-fluorothiophene-3-carbaldehyde?
The canonical SMILES for ethyl 2-fluoro-6H-thieno[2,3-b]pyrrole-5-carboxylate;5-fluorothiophene-3-carbaldehyde is CCOC(=O)c1cc2cc(F)sc2[nH]1.O=Cc1csc(F)c1.
What is the InChIKey of ethyl 2-fluoro-6H-thieno[2,3-b]pyrrole-5-carboxylate;5-fluorothiophene-3-carbaldehyde?
The InChIKey is SRJYBZPXEMTLBE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8FNO2S.C5H3FOS/c1-2-13-9(12)6-3-5-4-7(10)14-8(5)11-6;6-5-1-4(2-7)3-8-5/h3-4,11H,2H2,1H3;1-3H.
What are the key properties of ethyl 2-fluoro-6H-thieno[2,3-b]pyrrole-5-carboxylate;5-fluorothiophene-3-carbaldehyde?
ethyl 2-fluoro-6H-thieno[2,3-b]pyrrole-5-carboxylate;5-fluorothiophene-3-carbaldehyde has a molecular weight of 343.38 g/mol, XLogP of 4.24, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-fluoro-6H-thieno[2,3-b]pyrrole-5-carboxylate;5-fluorothiophene-3-carbaldehyde is sourced from PubChem (CID 160915892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).