About 10,10-diphenyl-8-piperidin-1-ylbenzo[b][1,4]benzazasilin-2-one
10,10-diphenyl-8-piperidin-1-ylbenzo[b][1,4]benzazasilin-2-one (PubChem CID 160916449) has the molecular formula C29H26N2OSi
and a molecular weight of 446.63 g/mol. Its IUPAC name is 10,10-diphenyl-8-piperidin-1-ylbenzo[b][1,4]benzazasilin-2-one.
Molecular Properties
| Compound Name | 10,10-diphenyl-8-piperidin-1-ylbenzo[b][1,4]benzazasilin-2-one |
| PubChem CID | 160916449 |
| Molecular Formula | C29H26N2OSi |
| Molecular Weight | 446.63 g/mol |
| Exact Mass | 446.18 |
| IUPAC Name | 10,10-diphenyl-8-piperidin-1-ylbenzo[b][1,4]benzazasilin-2-one |
| SMILES | O=C1C=CC2=Nc3ccc(N4CCCCC4)cc3[Si](c3ccccc3)(c3ccccc3)C2=C1 |
| InChI | InChI=1S/C29H26N2OSi/c32-23-15-17-27-29(21-23)33(24-10-4-1-5-11-24,25-12-6-2-7-13-25)28-20-22(14-16-26(28)30-27)31-18-8-3-9-19-31/h1-2,4-7,10-17,20-21H,3,8-9,18-19H2 |
| InChIKey | XHRHDLDVLQNEQJ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 446.63 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 10,10-diphenyl-8-piperidin-1-ylbenzo[b][1,4]benzazasilin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10,10-diphenyl-8-piperidin-1-ylbenzo[b][1,4]benzazasilin-2-one?
The IUPAC name of 10,10-diphenyl-8-piperidin-1-ylbenzo[b][1,4]benzazasilin-2-one (CID 160916449) is 10,10-diphenyl-8-piperidin-1-ylbenzo[b][1,4]benzazasilin-2-one.
What is the SMILES notation for 10,10-diphenyl-8-piperidin-1-ylbenzo[b][1,4]benzazasilin-2-one?
The canonical SMILES for 10,10-diphenyl-8-piperidin-1-ylbenzo[b][1,4]benzazasilin-2-one is O=C1C=CC2=Nc3ccc(N4CCCCC4)cc3[Si](c3ccccc3)(c3ccccc3)C2=C1.
What is the InChIKey of 10,10-diphenyl-8-piperidin-1-ylbenzo[b][1,4]benzazasilin-2-one?
The InChIKey is XHRHDLDVLQNEQJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C29H26N2OSi/c32-23-15-17-27-29(21-23)33(24-10-4-1-5-11-24,25-12-6-2-7-13-25)28-20-22(14-16-26(28)30-27)31-18-8-3-9-19-31/h1-2,4-7,10-17,20-21H,3,8-9,18-19H2.
What are the key properties of 10,10-diphenyl-8-piperidin-1-ylbenzo[b][1,4]benzazasilin-2-one?
10,10-diphenyl-8-piperidin-1-ylbenzo[b][1,4]benzazasilin-2-one has a molecular weight of 446.63 g/mol, XLogP of 3.84, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 10,10-diphenyl-8-piperidin-1-ylbenzo[b][1,4]benzazasilin-2-one is sourced from PubChem (CID 160916449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).