About 1-(4-nitrophenyl)ethanone;(E)-1-(4-nitrophenyl)-3-pyridin-4-ylprop-2-en-1-one
1-(4-nitrophenyl)ethanone;(E)-1-(4-nitrophenyl)-3-pyridin-4-ylprop-2-en-1-one (PubChem CID 160916469) has the molecular formula C22H17N3O6
and a molecular weight of 419.39 g/mol. Its IUPAC name is 1-(4-nitrophenyl)ethanone;(E)-1-(4-nitrophenyl)-3-pyridin-4-ylprop-2-en-1-one.
Molecular Properties
| Compound Name | 1-(4-nitrophenyl)ethanone;(E)-1-(4-nitrophenyl)-3-pyridin-4-ylprop-2-en-1-one |
| PubChem CID | 160916469 |
| Molecular Formula | C22H17N3O6 |
| Molecular Weight | 419.39 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | 1-(4-nitrophenyl)ethanone;(E)-1-(4-nitrophenyl)-3-pyridin-4-ylprop-2-en-1-one |
| SMILES | CC(=O)c1ccc([N+](=O)[O-])cc1.O=C(/C=C/c1ccncc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C14H10N2O3.C8H7NO3/c17-14(6-1-11-7-9-15-10-8-11)12-2-4-13(5-3-12)16(18)19;1-6(10)7-2-4-8(5-3-7)9(11)12/h1-10H;2-5H,1H3/b6-1+; |
| InChIKey | SRLUDVMKBAZOND-RRWNKNEUSA-N |
| XLogP | 4.68 |
| TPSA | 133.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 419.39 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(4-nitrophenyl)ethanone;(E)-1-(4-nitrophenyl)-3-pyridin-4-ylprop-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-nitrophenyl)ethanone;(E)-1-(4-nitrophenyl)-3-pyridin-4-ylprop-2-en-1-one?
The IUPAC name of 1-(4-nitrophenyl)ethanone;(E)-1-(4-nitrophenyl)-3-pyridin-4-ylprop-2-en-1-one (CID 160916469) is 1-(4-nitrophenyl)ethanone;(E)-1-(4-nitrophenyl)-3-pyridin-4-ylprop-2-en-1-one.
What is the SMILES notation for 1-(4-nitrophenyl)ethanone;(E)-1-(4-nitrophenyl)-3-pyridin-4-ylprop-2-en-1-one?
The canonical SMILES for 1-(4-nitrophenyl)ethanone;(E)-1-(4-nitrophenyl)-3-pyridin-4-ylprop-2-en-1-one is CC(=O)c1ccc([N+](=O)[O-])cc1.O=C(/C=C/c1ccncc1)c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of 1-(4-nitrophenyl)ethanone;(E)-1-(4-nitrophenyl)-3-pyridin-4-ylprop-2-en-1-one?
The InChIKey is SRLUDVMKBAZOND-RRWNKNEUSA-N. The full InChI is InChI=1S/C14H10N2O3.C8H7NO3/c17-14(6-1-11-7-9-15-10-8-11)12-2-4-13(5-3-12)16(18)19;1-6(10)7-2-4-8(5-3-7)9(11)12/h1-10H;2-5H,1H3/b6-1+;.
What are the key properties of 1-(4-nitrophenyl)ethanone;(E)-1-(4-nitrophenyl)-3-pyridin-4-ylprop-2-en-1-one?
1-(4-nitrophenyl)ethanone;(E)-1-(4-nitrophenyl)-3-pyridin-4-ylprop-2-en-1-one has a molecular weight of 419.39 g/mol, XLogP of 4.68, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-nitrophenyl)ethanone;(E)-1-(4-nitrophenyl)-3-pyridin-4-ylprop-2-en-1-one is sourced from PubChem (CID 160916469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).