C20H13ClN2O2 — CID 160918022
6-(5-chloro-4-oxocyclohexa-1,5-dien-1-yl)-7-phenyl-1H-1,8-naphthyridin-4-one (PubChem CID 160918022) has the molecular formula C20H13ClN2O2 and a molecular weight of 348.79 g/mol. Its IUPAC name is 6-(5-chloro-4-oxocyclohexa-1,5-dien-1-yl)-7-phenyl-1H-1,8-naphthyridin-4-one.
| Compound Name | 6-(5-chloro-4-oxocyclohexa-1,5-dien-1-yl)-7-phenyl-1H-1,8-naphthyridin-4-one |
|---|---|
| PubChem CID | 160918022 |
| Molecular Formula | C20H13ClN2O2 |
| Molecular Weight | 348.79 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | 6-(5-chloro-4-oxocyclohexa-1,5-dien-1-yl)-7-phenyl-1H-1,8-naphthyridin-4-one |
| SMILES | O=C1CC=C(c2cc3c(=O)cc[nH]c3nc2-c2ccccc2)C=C1Cl |
| InChI | InChI=1S/C20H13ClN2O2/c21-16-10-13(6-7-18(16)25)14-11-15-17(24)8-9-22-20(15)23-19(14)12-4-2-1-3-5-12/h1-6,8-11H,7H2,(H,22,23,24) |
| InChIKey | SRQWOJMUNOXXOF-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 62.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.79 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|