C25H31NO3 — CID 160920074
5-(dimethylamino)-1-[(2R,3S)-2-methyl-3-phenyl-7-propanoyl-2,3-dihydro-1-benzofuran-5-yl]pentan-1-one (PubChem CID 160920074) has the molecular formula C25H31NO3 and a molecular weight of 393.53 g/mol. Its IUPAC name is 5-(dimethylamino)-1-[(2R,3S)-2-methyl-3-phenyl-7-propanoyl-2,3-dihydro-1-benzofuran-5-yl]pentan-1-one.
| Compound Name | 5-(dimethylamino)-1-[(2R,3S)-2-methyl-3-phenyl-7-propanoyl-2,3-dihydro-1-benzofuran-5-yl]pentan-1-one |
|---|---|
| PubChem CID | 160920074 |
| Molecular Formula | C25H31NO3 |
| Molecular Weight | 393.53 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | 5-(dimethylamino)-1-[(2R,3S)-2-methyl-3-phenyl-7-propanoyl-2,3-dihydro-1-benzofuran-5-yl]pentan-1-one |
| SMILES | CCC(=O)c1cc(C(=O)CCCCN(C)C)cc2c1O[C@H](C)[C@H]2c1ccccc1 |
| InChI | InChI=1S/C25H31NO3/c1-5-22(27)20-15-19(23(28)13-9-10-14-26(3)4)16-21-24(17(2)29-25(20)21)18-11-7-6-8-12-18/h6-8,11-12,15-17,24H,5,9-10,13-14H2,1-4H3/t17-,24+/m1/s1 |
| InChIKey | SRXJJNJDCRJQOI-OSPHWJPCSA-N |
| XLogP | 5.11 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.53 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|