C12H28O2 — CID 160920366
2-methylpropane;2,2,4-trimethylpentane-1,3-diol (PubChem CID 160920366) has the molecular formula C12H28O2 and a molecular weight of 204.35 g/mol. Its IUPAC name is 2-methylpropane;2,2,4-trimethylpentane-1,3-diol.
| Compound Name | 2-methylpropane;2,2,4-trimethylpentane-1,3-diol |
|---|---|
| PubChem CID | 160920366 |
| Molecular Formula | C12H28O2 |
| Molecular Weight | 204.35 g/mol |
| Exact Mass | 204.21 |
| IUPAC Name | 2-methylpropane;2,2,4-trimethylpentane-1,3-diol |
| SMILES | CC(C)C.CC(C)C(O)C(C)(C)CO |
| InChI | InChI=1S/C8H18O2.C4H10/c1-6(2)7(10)8(3,4)5-9;1-4(2)3/h6-7,9-10H,5H2,1-4H3;4H,1-3H3 |
| InChIKey | SRYGJGPXOUCJDJ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.35 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |