C33H53N5O4 — CID 160920427
cyclopentyl (2S)-2-cyclohexyl-2-[[4-[3-[1-[5-(hydroxycarbamoyl)pyrimidin-2-yl]piperidin-4-yl]propyl]cyclohexyl]methylamino]acetate (PubChem CID 160920427) has the molecular formula C33H53N5O4 and a molecular weight of 583.82 g/mol. Its IUPAC name is cyclopentyl (2S)-2-cyclohexyl-2-[[4-[3-[1-[5-(hydroxycarbamoyl)pyrimidin-2-yl]piperidin-4-yl]propyl]cyclohexyl]methylamino]acetate.
| Compound Name | cyclopentyl (2S)-2-cyclohexyl-2-[[4-[3-[1-[5-(hydroxycarbamoyl)pyrimidin-2-yl]piperidin-4-yl]propyl]cyclohexyl]methylamino]acetate |
|---|---|
| PubChem CID | 160920427 |
| Molecular Formula | C33H53N5O4 |
| Molecular Weight | 583.82 g/mol |
| Exact Mass | 583.41 |
| IUPAC Name | cyclopentyl (2S)-2-cyclohexyl-2-[[4-[3-[1-[5-(hydroxycarbamoyl)pyrimidin-2-yl]piperidin-4-yl]propyl]cyclohexyl]methylamino]acetate |
| SMILES | O=C(NO)c1cnc(N2CCC(CCCC3CCC(CN[C@H](C(=O)OC4CCCC4)C4CCCCC4)CC3)CC2)nc1 |
| InChI | InChI=1S/C33H53N5O4/c39-31(37-41)28-22-35-33(36-23-28)38-19-17-25(18-20-38)8-6-7-24-13-15-26(16-14-24)21-34-30(27-9-2-1-3-10-27)32(40)42-29-11-4-5-12-29/h22-27,29-30,34,41H,1-21H2,(H,37,39)/t24?,26?,30-/m0/s1 |
| InChIKey | KPTMBEZZZUDAII-NEDUEJAKSA-N |
| XLogP | 5.81 |
| TPSA | 116.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.82 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|