C29H26Cl4F8N2O2Si — CID 160922641
6,7-dichloro-2-fluoro-1-(trifluoromethyl)-2,3,4,9-tetrahydrocarbazol-1-ol;[6,7-dichloro-2-fluoro-1-(trifluoromethyl)-2,3,4,9-tetrahydrocarbazol-1-yl]oxy-trimethylsilane (PubChem CID 160922641) has the molecular formula C29H26Cl4F8N2O2Si and a molecular weight of 756.42 g/mol. Its IUPAC name is 6,7-dichloro-2-fluoro-1-(trifluoromethyl)-2,3,4,9-tetrahydrocarbazol-1-ol;[6,7-dichloro-2-fluoro-1-(trifluoromethyl)-2,3,4,9-tetrahydrocarbazol-1-yl]oxy-trimethylsilane.
| Compound Name | 6,7-dichloro-2-fluoro-1-(trifluoromethyl)-2,3,4,9-tetrahydrocarbazol-1-ol;[6,7-dichloro-2-fluoro-1-(trifluoromethyl)-2,3,4,9-tetrahydrocarbazol-1-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 160922641 |
| Molecular Formula | C29H26Cl4F8N2O2Si |
| Molecular Weight | 756.42 g/mol |
| Exact Mass | 754.04 |
| IUPAC Name | 6,7-dichloro-2-fluoro-1-(trifluoromethyl)-2,3,4,9-tetrahydrocarbazol-1-ol;[6,7-dichloro-2-fluoro-1-(trifluoromethyl)-2,3,4,9-tetrahydrocarbazol-1-yl]oxy-trimethylsilane |
| SMILES | C[Si](C)(C)OC1(C(F)(F)F)c2[nH]c3cc(Cl)c(Cl)cc3c2CCC1F.OC1(C(F)(F)F)c2[nH]c3cc(Cl)c(Cl)cc3c2CCC1F |
| InChI | InChI=1S/C16H17Cl2F4NOSi.C13H9Cl2F4NO/c1-25(2,3)24-15(16(20,21)22)13(19)5-4-8-9-6-10(17)11(18)7-12(9)23-14(8)15;14-7-3-6-5-1-2-10(16)12(21,13(17,18)19)11(5)20-9(6)4-8(7)15/h6-7,13,23H,4-5H2,1-3H3;3-4,10,20-21H,1-2H2 |
| InChIKey | SSFQLMOYDAEZGH-UHFFFAOYSA-N |
| XLogP | 10.88 |
| TPSA | 61.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.42 |
| LogP ≤ 5 | 10.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|