About octadecanoic acid;octyl octanoate
octadecanoic acid;octyl octanoate (PubChem CID 160923684) has the molecular formula C34H68O4
and a molecular weight of 540.91 g/mol. Its IUPAC name is octadecanoic acid;octyl octanoate.
Molecular Properties
| Compound Name | octadecanoic acid;octyl octanoate |
| PubChem CID | 160923684 |
| Molecular Formula | C34H68O4 |
| Molecular Weight | 540.91 g/mol |
| Exact Mass | 540.51 |
| IUPAC Name | octadecanoic acid;octyl octanoate |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)O.CCCCCCCCOC(=O)CCCCCCC |
| InChI | InChI=1S/C18H36O2.C16H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-3-5-7-9-11-13-15-18-16(17)14-12-10-8-6-4-2/h2-17H2,1H3,(H,19,20);3-15H2,1-2H3 |
| InChIKey | SSJCDTZBUOPXMO-UHFFFAOYSA-N |
| XLogP | 11.58 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 540.91 |
| LogP ≤ 5 | 11.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze octadecanoic acid;octyl octanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octadecanoic acid;octyl octanoate?
The IUPAC name of octadecanoic acid;octyl octanoate (CID 160923684) is octadecanoic acid;octyl octanoate.
What is the SMILES notation for octadecanoic acid;octyl octanoate?
The canonical SMILES for octadecanoic acid;octyl octanoate is CCCCCCCCCCCCCCCCCC(=O)O.CCCCCCCCOC(=O)CCCCCCC.
What is the InChIKey of octadecanoic acid;octyl octanoate?
The InChIKey is SSJCDTZBUOPXMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36O2.C16H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-3-5-7-9-11-13-15-18-16(17)14-12-10-8-6-4-2/h2-17H2,1H3,(H,19,20);3-15H2,1-2H3.
What are the key properties of octadecanoic acid;octyl octanoate?
octadecanoic acid;octyl octanoate has a molecular weight of 540.91 g/mol, XLogP of 11.58, 29 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for octadecanoic acid;octyl octanoate is sourced from PubChem (CID 160923684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).