C25H24N2O4 — CID 160924551
N-[[4-[(E)-2,5-dioxohex-3-enyl]phenyl]methyl]-N-(2-hydroxyethyl)quinoline-8-carboxamide (PubChem CID 160924551) has the molecular formula C25H24N2O4 and a molecular weight of 416.48 g/mol. Its IUPAC name is N-[[4-[(E)-2,5-dioxohex-3-enyl]phenyl]methyl]-N-(2-hydroxyethyl)quinoline-8-carboxamide.
| Compound Name | N-[[4-[(E)-2,5-dioxohex-3-enyl]phenyl]methyl]-N-(2-hydroxyethyl)quinoline-8-carboxamide |
|---|---|
| PubChem CID | 160924551 |
| Molecular Formula | C25H24N2O4 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | N-[[4-[(E)-2,5-dioxohex-3-enyl]phenyl]methyl]-N-(2-hydroxyethyl)quinoline-8-carboxamide |
| SMILES | CC(=O)/C=C/C(=O)Cc1ccc(CN(CCO)C(=O)c2cccc3cccnc23)cc1 |
| InChI | InChI=1S/C25H24N2O4/c1-18(29)7-12-22(30)16-19-8-10-20(11-9-19)17-27(14-15-28)25(31)23-6-2-4-21-5-3-13-26-24(21)23/h2-13,28H,14-17H2,1H3/b12-7+ |
| InChIKey | CBMBZLMDQYMILB-KPKJPENVSA-N |
| XLogP | 3.13 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|