About 1-[4-(4-bromobutoxy)phenyl]sulfonyl-2-propan-2-ylindolizine;cyclohexane
1-[4-(4-bromobutoxy)phenyl]sulfonyl-2-propan-2-ylindolizine;cyclohexane (PubChem CID 160924668) has the molecular formula C27H36BrNO3S
and a molecular weight of 534.56 g/mol. Its IUPAC name is 1-[4-(4-bromobutoxy)phenyl]sulfonyl-2-propan-2-ylindolizine;cyclohexane.
Molecular Properties
| Compound Name | 1-[4-(4-bromobutoxy)phenyl]sulfonyl-2-propan-2-ylindolizine;cyclohexane |
| PubChem CID | 160924668 |
| Molecular Formula | C27H36BrNO3S |
| Molecular Weight | 534.56 g/mol |
| Exact Mass | 533.16 |
| IUPAC Name | 1-[4-(4-bromobutoxy)phenyl]sulfonyl-2-propan-2-ylindolizine;cyclohexane |
| SMILES | C1CCCCC1.CC(C)c1cn2ccccc2c1S(=O)(=O)c1ccc(OCCCCBr)cc1 |
| InChI | InChI=1S/C21H24BrNO3S.C6H12/c1-16(2)19-15-23-13-5-3-7-20(23)21(19)27(24,25)18-10-8-17(9-11-18)26-14-6-4-12-22;1-2-4-6-5-3-1/h3,5,7-11,13,15-16H,4,6,12,14H2,1-2H3;1-6H2 |
| InChIKey | SSMHZXPEJGLIQT-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 534.56 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(4-bromobutoxy)phenyl]sulfonyl-2-propan-2-ylindolizine;cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(4-bromobutoxy)phenyl]sulfonyl-2-propan-2-ylindolizine;cyclohexane?
The IUPAC name of 1-[4-(4-bromobutoxy)phenyl]sulfonyl-2-propan-2-ylindolizine;cyclohexane (CID 160924668) is 1-[4-(4-bromobutoxy)phenyl]sulfonyl-2-propan-2-ylindolizine;cyclohexane.
What is the SMILES notation for 1-[4-(4-bromobutoxy)phenyl]sulfonyl-2-propan-2-ylindolizine;cyclohexane?
The canonical SMILES for 1-[4-(4-bromobutoxy)phenyl]sulfonyl-2-propan-2-ylindolizine;cyclohexane is C1CCCCC1.CC(C)c1cn2ccccc2c1S(=O)(=O)c1ccc(OCCCCBr)cc1.
What is the InChIKey of 1-[4-(4-bromobutoxy)phenyl]sulfonyl-2-propan-2-ylindolizine;cyclohexane?
The InChIKey is SSMHZXPEJGLIQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24BrNO3S.C6H12/c1-16(2)19-15-23-13-5-3-7-20(23)21(19)27(24,25)18-10-8-17(9-11-18)26-14-6-4-12-22;1-2-4-6-5-3-1/h3,5,7-11,13,15-16H,4,6,12,14H2,1-2H3;1-6H2.
What are the key properties of 1-[4-(4-bromobutoxy)phenyl]sulfonyl-2-propan-2-ylindolizine;cyclohexane?
1-[4-(4-bromobutoxy)phenyl]sulfonyl-2-propan-2-ylindolizine;cyclohexane has a molecular weight of 534.56 g/mol, XLogP of 7.79, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(4-bromobutoxy)phenyl]sulfonyl-2-propan-2-ylindolizine;cyclohexane is sourced from PubChem (CID 160924668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).