About (1-ethenyl-3-methylimidazol-2-ylidene)platinum;(4-methylphenyl)methanamine
(1-ethenyl-3-methylimidazol-2-ylidene)platinum;(4-methylphenyl)methanamine (PubChem CID 160927601) has the molecular formula C14H19N3Pt
and a molecular weight of 424.41 g/mol. Its IUPAC name is (1-ethenyl-3-methylimidazol-2-ylidene)platinum;(4-methylphenyl)methanamine.
Molecular Properties
| Compound Name | (1-ethenyl-3-methylimidazol-2-ylidene)platinum;(4-methylphenyl)methanamine |
| PubChem CID | 160927601 |
| Molecular Formula | C14H19N3Pt |
| Molecular Weight | 424.41 g/mol |
| Exact Mass | 424.12 |
| IUPAC Name | (1-ethenyl-3-methylimidazol-2-ylidene)platinum;(4-methylphenyl)methanamine |
| SMILES | C=Cn1ccn(C)c1=[Pt].Cc1ccc(CN)cc1 |
| InChI | InChI=1S/C8H11N.C6H8N2.Pt/c1-7-2-4-8(6-9)5-3-7;1-3-8-5-4-7(2)6-8;/h2-5H,6,9H2,1H3;3-5H,1H2,2H3; |
| InChIKey | SSVRNEOXQDCSOW-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 424.41 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1-ethenyl-3-methylimidazol-2-ylidene)platinum;(4-methylphenyl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-ethenyl-3-methylimidazol-2-ylidene)platinum;(4-methylphenyl)methanamine?
The IUPAC name of (1-ethenyl-3-methylimidazol-2-ylidene)platinum;(4-methylphenyl)methanamine (CID 160927601) is (1-ethenyl-3-methylimidazol-2-ylidene)platinum;(4-methylphenyl)methanamine.
What is the SMILES notation for (1-ethenyl-3-methylimidazol-2-ylidene)platinum;(4-methylphenyl)methanamine?
The canonical SMILES for (1-ethenyl-3-methylimidazol-2-ylidene)platinum;(4-methylphenyl)methanamine is C=Cn1ccn(C)c1=[Pt].Cc1ccc(CN)cc1.
What is the InChIKey of (1-ethenyl-3-methylimidazol-2-ylidene)platinum;(4-methylphenyl)methanamine?
The InChIKey is SSVRNEOXQDCSOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N.C6H8N2.Pt/c1-7-2-4-8(6-9)5-3-7;1-3-8-5-4-7(2)6-8;/h2-5H,6,9H2,1H3;3-5H,1H2,2H3;.
What are the key properties of (1-ethenyl-3-methylimidazol-2-ylidene)platinum;(4-methylphenyl)methanamine?
(1-ethenyl-3-methylimidazol-2-ylidene)platinum;(4-methylphenyl)methanamine has a molecular weight of 424.41 g/mol, XLogP of 2.46, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1-ethenyl-3-methylimidazol-2-ylidene)platinum;(4-methylphenyl)methanamine is sourced from PubChem (CID 160927601), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).