About methyl 2,4-dimethyl-4-nitropentanoate;methyl 2-methylprop-2-enoate;2-nitropropane
methyl 2,4-dimethyl-4-nitropentanoate;methyl 2-methylprop-2-enoate;2-nitropropane (PubChem CID 160929866) has the molecular formula C16H30N2O8
and a molecular weight of 378.42 g/mol. Its IUPAC name is methyl 2,4-dimethyl-4-nitropentanoate;methyl 2-methylprop-2-enoate;2-nitropropane.
Molecular Properties
| Compound Name | methyl 2,4-dimethyl-4-nitropentanoate;methyl 2-methylprop-2-enoate;2-nitropropane |
| PubChem CID | 160929866 |
| Molecular Formula | C16H30N2O8 |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.20 |
| IUPAC Name | methyl 2,4-dimethyl-4-nitropentanoate;methyl 2-methylprop-2-enoate;2-nitropropane |
| SMILES | C=C(C)C(=O)OC.CC(C)[N+](=O)[O-].COC(=O)C(C)CC(C)(C)[N+](=O)[O-] |
| InChI | InChI=1S/C8H15NO4.C5H8O2.C3H7NO2/c1-6(7(10)13-4)5-8(2,3)9(11)12;1-4(2)5(6)7-3;1-3(2)4(5)6/h6H,5H2,1-4H3;1H2,2-3H3;3H,1-2H3 |
| InChIKey | STCUREQPLURPDI-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 138.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 2,4-dimethyl-4-nitropentanoate;methyl 2-methylprop-2-enoate;2-nitropropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2,4-dimethyl-4-nitropentanoate;methyl 2-methylprop-2-enoate;2-nitropropane?
The IUPAC name of methyl 2,4-dimethyl-4-nitropentanoate;methyl 2-methylprop-2-enoate;2-nitropropane (CID 160929866) is methyl 2,4-dimethyl-4-nitropentanoate;methyl 2-methylprop-2-enoate;2-nitropropane.
What is the SMILES notation for methyl 2,4-dimethyl-4-nitropentanoate;methyl 2-methylprop-2-enoate;2-nitropropane?
The canonical SMILES for methyl 2,4-dimethyl-4-nitropentanoate;methyl 2-methylprop-2-enoate;2-nitropropane is C=C(C)C(=O)OC.CC(C)[N+](=O)[O-].COC(=O)C(C)CC(C)(C)[N+](=O)[O-].
What is the InChIKey of methyl 2,4-dimethyl-4-nitropentanoate;methyl 2-methylprop-2-enoate;2-nitropropane?
The InChIKey is STCUREQPLURPDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO4.C5H8O2.C3H7NO2/c1-6(7(10)13-4)5-8(2,3)9(11)12;1-4(2)5(6)7-3;1-3(2)4(5)6/h6H,5H2,1-4H3;1H2,2-3H3;3H,1-2H3.
What are the key properties of methyl 2,4-dimethyl-4-nitropentanoate;methyl 2-methylprop-2-enoate;2-nitropropane?
methyl 2,4-dimethyl-4-nitropentanoate;methyl 2-methylprop-2-enoate;2-nitropropane has a molecular weight of 378.42 g/mol, XLogP of 2.65, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2,4-dimethyl-4-nitropentanoate;methyl 2-methylprop-2-enoate;2-nitropropane is sourced from PubChem (CID 160929866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).