About 5-(5-chloro-2-methyl-1,3-thiazol-4-yl)-5-oxopentanamide
5-(5-chloro-2-methyl-1,3-thiazol-4-yl)-5-oxopentanamide (PubChem CID 160931303) has the molecular formula C9H11ClN2O2S
and a molecular weight of 246.72 g/mol. Its IUPAC name is 5-(5-chloro-2-methyl-1,3-thiazol-4-yl)-5-oxopentanamide.
Molecular Properties
| Compound Name | 5-(5-chloro-2-methyl-1,3-thiazol-4-yl)-5-oxopentanamide |
| PubChem CID | 160931303 |
| Molecular Formula | C9H11ClN2O2S |
| Molecular Weight | 246.72 g/mol |
| Exact Mass | 246.02 |
| IUPAC Name | 5-(5-chloro-2-methyl-1,3-thiazol-4-yl)-5-oxopentanamide |
| SMILES | Cc1nc(C(=O)CCCC(N)=O)c(Cl)s1 |
| InChI | InChI=1S/C9H11ClN2O2S/c1-5-12-8(9(10)15-5)6(13)3-2-4-7(11)14/h2-4H2,1H3,(H2,11,14) |
| InChIKey | UCKJFQYKQCBBKY-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.72 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(5-chloro-2-methyl-1,3-thiazol-4-yl)-5-oxopentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(5-chloro-2-methyl-1,3-thiazol-4-yl)-5-oxopentanamide?
The IUPAC name of 5-(5-chloro-2-methyl-1,3-thiazol-4-yl)-5-oxopentanamide (CID 160931303) is 5-(5-chloro-2-methyl-1,3-thiazol-4-yl)-5-oxopentanamide.
What is the SMILES notation for 5-(5-chloro-2-methyl-1,3-thiazol-4-yl)-5-oxopentanamide?
The canonical SMILES for 5-(5-chloro-2-methyl-1,3-thiazol-4-yl)-5-oxopentanamide is Cc1nc(C(=O)CCCC(N)=O)c(Cl)s1.
What is the InChIKey of 5-(5-chloro-2-methyl-1,3-thiazol-4-yl)-5-oxopentanamide?
The InChIKey is UCKJFQYKQCBBKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11ClN2O2S/c1-5-12-8(9(10)15-5)6(13)3-2-4-7(11)14/h2-4H2,1H3,(H2,11,14).
What are the key properties of 5-(5-chloro-2-methyl-1,3-thiazol-4-yl)-5-oxopentanamide?
5-(5-chloro-2-methyl-1,3-thiazol-4-yl)-5-oxopentanamide has a molecular weight of 246.72 g/mol, XLogP of 1.94, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(5-chloro-2-methyl-1,3-thiazol-4-yl)-5-oxopentanamide is sourced from PubChem (CID 160931303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).