C9H13N2O+ — CID 160931640
carbanylium;(6R)-6-methyl-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-one (PubChem CID 160931640) has the molecular formula C9H13N2O+ and a molecular weight of 165.22 g/mol. Its IUPAC name is carbanylium;(6R)-6-methyl-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-one.
| Compound Name | carbanylium;(6R)-6-methyl-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-one |
|---|---|
| PubChem CID | 160931640 |
| Molecular Formula | C9H13N2O+ |
| Molecular Weight | 165.22 g/mol |
| Exact Mass | 165.10 |
| IUPAC Name | carbanylium;(6R)-6-methyl-7,8-dihydro-6H-pyrrolo[1,2-a]pyrimidin-4-one |
| SMILES | C[C@@H]1CCc2nccc(=O)n21.[CH3+] |
| InChI | InChI=1S/C8H10N2O.CH3/c1-6-2-3-7-9-5-4-8(11)10(6)7;/h4-6H,2-3H2,1H3;1H3/q;+1/t6-;/m1./s1 |
| InChIKey | STIRMVYWPDSDOZ-FYZOBXCZSA-N |
| XLogP | 1.20 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.22 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|