C19H21BrNO3P — CID 160935046
[amino(phenyl)methyl]phosphonic acid;1,1'-biphenyl;hydrobromide (PubChem CID 160935046) has the molecular formula C19H21BrNO3P and a molecular weight of 422.26 g/mol. Its IUPAC name is [amino(phenyl)methyl]phosphonic acid;1,1'-biphenyl;hydrobromide.
| Compound Name | [amino(phenyl)methyl]phosphonic acid;1,1'-biphenyl;hydrobromide |
|---|---|
| PubChem CID | 160935046 |
| Molecular Formula | C19H21BrNO3P |
| Molecular Weight | 422.26 g/mol |
| Exact Mass | 421.04 |
| IUPAC Name | [amino(phenyl)methyl]phosphonic acid;1,1'-biphenyl;hydrobromide |
| SMILES | Br.NC(c1ccccc1)P(=O)(O)O.c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C12H10.C7H10NO3P.BrH/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;8-7(12(9,10)11)6-4-2-1-3-5-6;/h1-10H;1-5,7H,8H2,(H2,9,10,11);1H |
| InChIKey | STTPIEJZSZSPOM-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.26 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|