C22H19NO5P- — CID 160935239
2-acetamidoethyl 7-ethylpentadeca-7,8,9,10,11,12,13,14-octaen-1,3,5-triynyl phosphate;methane (PubChem CID 160935239) has the molecular formula C22H19NO5P- and a molecular weight of 408.37 g/mol. Its IUPAC name is 2-acetamidoethyl 7-ethylpentadeca-7,8,9,10,11,12,13,14-octaen-1,3,5-triynyl phosphate;methane.
| Compound Name | 2-acetamidoethyl 7-ethylpentadeca-7,8,9,10,11,12,13,14-octaen-1,3,5-triynyl phosphate;methane |
|---|---|
| PubChem CID | 160935239 |
| Molecular Formula | C22H19NO5P- |
| Molecular Weight | 408.37 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | 2-acetamidoethyl 7-ethylpentadeca-7,8,9,10,11,12,13,14-octaen-1,3,5-triynyl phosphate;methane |
| SMILES | C.C=C=C=C=C=C=C=C=C(C#CC#CC#COP(=O)([O-])OCCNC(C)=O)CC |
| InChI | InChI=1S/C21H16NO5P.CH4/c1-4-6-7-8-9-12-15-21(5-2)16-13-10-11-14-18-26-28(24,25)27-19-17-22-20(3)23;/h1,5,17,19H2,2-3H3,(H,22,23)(H,24,25);1H4/p-1 |
| InChIKey | STUFJJKNOPWMSW-UHFFFAOYSA-M |
| XLogP | 2.28 |
| TPSA | 87.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.37 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|