C27H44O4 — CID 160936006
(1S,3S,4S,6R)-4,6-dimethyl-5-(3-methylbut-2-enylidene)cyclohexane-1,3-diol;(1R,3R,4S,6R)-4,6-dimethyl-5-(3-methylbut-2-enylidene)-2-methylidenecyclohexane-1,3-diol (PubChem CID 160936006) has the molecular formula C27H44O4 and a molecular weight of 432.65 g/mol. Its IUPAC name is (1S,3S,4S,6R)-4,6-dimethyl-5-(3-methylbut-2-enylidene)cyclohexane-1,3-diol;(1R,3R,4S,6R)-4,6-dimethyl-5-(3-methylbut-2-enylidene)-2-methylidenecyclohexane-1,3-diol.
| Compound Name | (1S,3S,4S,6R)-4,6-dimethyl-5-(3-methylbut-2-enylidene)cyclohexane-1,3-diol;(1R,3R,4S,6R)-4,6-dimethyl-5-(3-methylbut-2-enylidene)-2-methylidenecyclohexane-1,3-diol |
|---|---|
| PubChem CID | 160936006 |
| Molecular Formula | C27H44O4 |
| Molecular Weight | 432.65 g/mol |
| Exact Mass | 432.32 |
| IUPAC Name | (1S,3S,4S,6R)-4,6-dimethyl-5-(3-methylbut-2-enylidene)cyclohexane-1,3-diol;(1R,3R,4S,6R)-4,6-dimethyl-5-(3-methylbut-2-enylidene)-2-methylidenecyclohexane-1,3-diol |
| SMILES | C=C1[C@H](O)[C@H](C)/C(=C\C=C(C)C)[C@H](C)[C@H]1O.CC(C)=C/C=C1\[C@@H](C)[C@@H](O)C[C@H](O)[C@H]1C |
| InChI | InChI=1S/C14H22O2.C13H22O2/c1-8(2)6-7-12-9(3)13(15)11(5)14(16)10(12)4;1-8(2)5-6-11-9(3)12(14)7-13(15)10(11)4/h6-7,9-10,13-16H,5H2,1-4H3;5-6,9-10,12-15H,7H2,1-4H3/b12-7-;11-6-/t9-,10+,13+,14+;9-,10+,12-,13-/m00/s1 |
| InChIKey | STWOCXUNVUKEFU-FBPHSSJJSA-N |
| XLogP | 4.72 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.65 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|