C17H26N4O7 — CID 160936317
N,N-dimethyl-1-(oxiran-2-yl)methanamine;1,3,5-tris(oxiran-2-ylmethyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 160936317) has the molecular formula C17H26N4O7 and a molecular weight of 398.42 g/mol. Its IUPAC name is N,N-dimethyl-1-(oxiran-2-yl)methanamine;1,3,5-tris(oxiran-2-ylmethyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | N,N-dimethyl-1-(oxiran-2-yl)methanamine;1,3,5-tris(oxiran-2-ylmethyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 160936317 |
| Molecular Formula | C17H26N4O7 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | N,N-dimethyl-1-(oxiran-2-yl)methanamine;1,3,5-tris(oxiran-2-ylmethyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | CN(C)CC1CO1.O=c1n(CC2CO2)c(=O)n(CC2CO2)c(=O)n1CC1CO1 |
| InChI | InChI=1S/C12H15N3O6.C5H11NO/c16-10-13(1-7-4-19-7)11(17)15(3-9-6-21-9)12(18)14(10)2-8-5-20-8;1-6(2)3-5-4-7-5/h7-9H,1-6H2;5H,3-4H2,1-2H3 |
| InChIKey | STXQVMQZJFBNOI-UHFFFAOYSA-N |
| XLogP | -2.69 |
| TPSA | 119.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | -2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|