C31H28F9N7 — CID 160936418
1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-[(5S)-1-[(3-cyanophenyl)methyl]-7-methyl-8-(trifluoromethyl)-2,3,4,5-tetrahydro-1-benzazepin-5-yl]-2-(methyldiazenyl)guanidine (PubChem CID 160936418) has the molecular formula C31H28F9N7 and a molecular weight of 669.60 g/mol. Its IUPAC name is 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-[(5S)-1-[(3-cyanophenyl)methyl]-7-methyl-8-(trifluoromethyl)-2,3,4,5-tetrahydro-1-benzazepin-5-yl]-2-(methyldiazenyl)guanidine.
| Compound Name | 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-[(5S)-1-[(3-cyanophenyl)methyl]-7-methyl-8-(trifluoromethyl)-2,3,4,5-tetrahydro-1-benzazepin-5-yl]-2-(methyldiazenyl)guanidine |
|---|---|
| PubChem CID | 160936418 |
| Molecular Formula | C31H28F9N7 |
| Molecular Weight | 669.60 g/mol |
| Exact Mass | 669.23 |
| IUPAC Name | 1-[[3,5-bis(trifluoromethyl)phenyl]methyl]-1-[(5S)-1-[(3-cyanophenyl)methyl]-7-methyl-8-(trifluoromethyl)-2,3,4,5-tetrahydro-1-benzazepin-5-yl]-2-(methyldiazenyl)guanidine |
| SMILES | C/N=N/N=C(N)N(Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)[C@H]1CCCN(Cc2cccc(C#N)c2)c2cc(C(F)(F)F)c(C)cc21 |
| InChI | InChI=1S/C31H28F9N7/c1-18-9-24-26(7-4-8-46(27(24)14-25(18)31(38,39)40)16-20-6-3-5-19(10-20)15-41)47(28(42)44-45-43-2)17-21-11-22(29(32,33)34)13-23(12-21)30(35,36)37/h3,5-6,9-14,26H,4,7-8,16-17H2,1-2H3,(H2,42,43,44)/t26-/m0/s1 |
| InChIKey | STXZPDQXIDELTE-SANMLTNESA-N |
| XLogP | 8.58 |
| TPSA | 93.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.60 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|