About trans-(1S,2R)-2-[6-(4-isocyanophenyl)-3-pyridinyl]cyclopropan-1-amine;dihydrochloride
trans-(1S,2R)-2-[6-(4-isocyanophenyl)-3-pyridinyl]cyclopropan-1-amine;dihydrochloride (PubChem CID 160936629) has the molecular formula C15H15Cl2N3
and a molecular weight of 308.21 g/mol. Its IUPAC name is trans-(1S,2R)-2-[6-(4-isocyanophenyl)-3-pyridinyl]cyclopropan-1-amine;dihydrochloride.
Molecular Properties
| Compound Name | trans-(1S,2R)-2-[6-(4-isocyanophenyl)-3-pyridinyl]cyclopropan-1-amine;dihydrochloride |
| PubChem CID | 160936629 |
| Molecular Formula | C15H15Cl2N3 |
| Molecular Weight | 308.21 g/mol |
| Exact Mass | 307.06 |
| IUPAC Name | trans-(1S,2R)-2-[6-(4-isocyanophenyl)-3-pyridinyl]cyclopropan-1-amine;dihydrochloride |
| SMILES | Cl.Cl.[C-]#[N+]c1ccc(-c2ccc([C@H]3C[C@@H]3N)cn2)cc1 |
| InChI | InChI=1S/C15H13N3.2ClH/c1-17-12-5-2-10(3-6-12)15-7-4-11(9-18-15)13-8-14(13)16;;/h2-7,9,13-14H,8,16H2;2*1H/t13-,14+;;/m1../s1 |
| InChIKey | WGRIQYBIRUAANH-BQFBZIMZSA-N |
| XLogP | 3.96 |
| TPSA | 43.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.21 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze trans-(1S,2R)-2-[6-(4-isocyanophenyl)-3-pyridinyl]cyclopropan-1-amine;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(1S,2R)-2-[6-(4-isocyanophenyl)-3-pyridinyl]cyclopropan-1-amine;dihydrochloride?
The IUPAC name of trans-(1S,2R)-2-[6-(4-isocyanophenyl)-3-pyridinyl]cyclopropan-1-amine;dihydrochloride (CID 160936629) is trans-(1S,2R)-2-[6-(4-isocyanophenyl)-3-pyridinyl]cyclopropan-1-amine;dihydrochloride.
What is the SMILES notation for trans-(1S,2R)-2-[6-(4-isocyanophenyl)-3-pyridinyl]cyclopropan-1-amine;dihydrochloride?
The canonical SMILES for trans-(1S,2R)-2-[6-(4-isocyanophenyl)-3-pyridinyl]cyclopropan-1-amine;dihydrochloride is Cl.Cl.[C-]#[N+]c1ccc(-c2ccc([C@H]3C[C@@H]3N)cn2)cc1.
What is the InChIKey of trans-(1S,2R)-2-[6-(4-isocyanophenyl)-3-pyridinyl]cyclopropan-1-amine;dihydrochloride?
The InChIKey is WGRIQYBIRUAANH-BQFBZIMZSA-N. The full InChI is InChI=1S/C15H13N3.2ClH/c1-17-12-5-2-10(3-6-12)15-7-4-11(9-18-15)13-8-14(13)16;;/h2-7,9,13-14H,8,16H2;2*1H/t13-,14+;;/m1../s1.
What are the key properties of trans-(1S,2R)-2-[6-(4-isocyanophenyl)-3-pyridinyl]cyclopropan-1-amine;dihydrochloride?
trans-(1S,2R)-2-[6-(4-isocyanophenyl)-3-pyridinyl]cyclopropan-1-amine;dihydrochloride has a molecular weight of 308.21 g/mol, XLogP of 3.96, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(1S,2R)-2-[6-(4-isocyanophenyl)-3-pyridinyl]cyclopropan-1-amine;dihydrochloride is sourced from PubChem (CID 160936629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).