C24H30N2O4 — CID 160937498
2,4-bis(1-ethyl-4-hydroxy-2,3-dihydroindol-5-yl)cyclobutane-1,3-diol (PubChem CID 160937498) has the molecular formula C24H30N2O4 and a molecular weight of 410.51 g/mol. Its IUPAC name is 2,4-bis(1-ethyl-4-hydroxy-2,3-dihydroindol-5-yl)cyclobutane-1,3-diol.
| Compound Name | 2,4-bis(1-ethyl-4-hydroxy-2,3-dihydroindol-5-yl)cyclobutane-1,3-diol |
|---|---|
| PubChem CID | 160937498 |
| Molecular Formula | C24H30N2O4 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | 2,4-bis(1-ethyl-4-hydroxy-2,3-dihydroindol-5-yl)cyclobutane-1,3-diol |
| SMILES | CCN1CCc2c1ccc(C1C(O)C(c3ccc4c(c3O)CCN4CC)C1O)c2O |
| InChI | InChI=1S/C24H30N2O4/c1-3-25-11-9-13-17(25)7-5-15(21(13)27)19-23(29)20(24(19)30)16-6-8-18-14(22(16)28)10-12-26(18)4-2/h5-8,19-20,23-24,27-30H,3-4,9-12H2,1-2H3 |
| InChIKey | XXRRIIXDKDYYIZ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 87.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |