C40H37N2O8+ — CID 160937673
2-[2-(2,4-dioxocyclohexyl)-1-oxoisoindol-2-ium-5-yl]oxy-N-[2-[4-[(3S,4R)-7-hydroxy-3-phenyl-3,4-dihydro-2H-chromen-4-yl]phenoxy]ethyl]-N-methylacetamide (PubChem CID 160937673) has the molecular formula C40H37N2O8+ and a molecular weight of 673.74 g/mol. Its IUPAC name is 2-[2-(2,4-dioxocyclohexyl)-1-oxoisoindol-2-ium-5-yl]oxy-N-[2-[4-[(3S,4R)-7-hydroxy-3-phenyl-3,4-dihydro-2H-chromen-4-yl]phenoxy]ethyl]-N-methylacetamide.
| Compound Name | 2-[2-(2,4-dioxocyclohexyl)-1-oxoisoindol-2-ium-5-yl]oxy-N-[2-[4-[(3S,4R)-7-hydroxy-3-phenyl-3,4-dihydro-2H-chromen-4-yl]phenoxy]ethyl]-N-methylacetamide |
|---|---|
| PubChem CID | 160937673 |
| Molecular Formula | C40H37N2O8+ |
| Molecular Weight | 673.74 g/mol |
| Exact Mass | 673.25 |
| IUPAC Name | 2-[2-(2,4-dioxocyclohexyl)-1-oxoisoindol-2-ium-5-yl]oxy-N-[2-[4-[(3S,4R)-7-hydroxy-3-phenyl-3,4-dihydro-2H-chromen-4-yl]phenoxy]ethyl]-N-methylacetamide |
| SMILES | CN(CCOc1ccc([C@@H]2c3ccc(O)cc3OC[C@@H]2c2ccccc2)cc1)C(=O)COc1ccc2c(c1)C=[N+](C1CCC(=O)CC1=O)C2=O |
| InChI | InChI=1S/C40H36N2O8/c1-41(38(46)24-49-31-13-15-32-27(19-31)22-42(40(32)47)35-16-10-28(43)20-36(35)45)17-18-48-30-11-7-26(8-12-30)39-33-14-9-29(44)21-37(33)50-23-34(39)25-5-3-2-4-6-25/h2-9,11-15,19,21-22,34-35,39H,10,16-18,20,23-24H2,1H3/p+1/t34-,35?,39-/m1/s1 |
| InChIKey | DDOQHROHNXMCKY-JQCNZCBESA-O |
| XLogP | 4.89 |
| TPSA | 122.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.74 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|