About 2-methylbutane;7-(2-methylpropyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine
2-methylbutane;7-(2-methylpropyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine (PubChem CID 160938610) has the molecular formula C15H29N3
and a molecular weight of 251.42 g/mol. Its IUPAC name is 2-methylbutane;7-(2-methylpropyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine.
Molecular Properties
| Compound Name | 2-methylbutane;7-(2-methylpropyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine |
| PubChem CID | 160938610 |
| Molecular Formula | C15H29N3 |
| Molecular Weight | 251.42 g/mol |
| Exact Mass | 251.24 |
| IUPAC Name | 2-methylbutane;7-(2-methylpropyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine |
| SMILES | CC(C)CN1CCn2ccnc2C1.CCC(C)C |
| InChI | InChI=1S/C10H17N3.C5H12/c1-9(2)7-12-5-6-13-4-3-11-10(13)8-12;1-4-5(2)3/h3-4,9H,5-8H2,1-2H3;5H,4H2,1-3H3 |
| InChIKey | SUEZOQZBXCEHNB-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 251.42 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methylbutane;7-(2-methylpropyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylbutane;7-(2-methylpropyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine?
The IUPAC name of 2-methylbutane;7-(2-methylpropyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine (CID 160938610) is 2-methylbutane;7-(2-methylpropyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine.
What is the SMILES notation for 2-methylbutane;7-(2-methylpropyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine?
The canonical SMILES for 2-methylbutane;7-(2-methylpropyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine is CC(C)CN1CCn2ccnc2C1.CCC(C)C.
What is the InChIKey of 2-methylbutane;7-(2-methylpropyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine?
The InChIKey is SUEZOQZBXCEHNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3.C5H12/c1-9(2)7-12-5-6-13-4-3-11-10(13)8-12;1-4-5(2)3/h3-4,9H,5-8H2,1-2H3;5H,4H2,1-3H3.
What are the key properties of 2-methylbutane;7-(2-methylpropyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine?
2-methylbutane;7-(2-methylpropyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine has a molecular weight of 251.42 g/mol, XLogP of 3.41, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylbutane;7-(2-methylpropyl)-6,8-dihydro-5H-imidazo[1,2-a]pyrazine is sourced from PubChem (CID 160938610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).