C27H35N5O4 — CID 160939165
4-amino-1-(4-methylphenyl)piperidine-4-carboxylic acid;8-(4-methylphenyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 160939165) has the molecular formula C27H35N5O4 and a molecular weight of 493.61 g/mol. Its IUPAC name is 4-amino-1-(4-methylphenyl)piperidine-4-carboxylic acid;8-(4-methylphenyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 4-amino-1-(4-methylphenyl)piperidine-4-carboxylic acid;8-(4-methylphenyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 160939165 |
| Molecular Formula | C27H35N5O4 |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.27 |
| IUPAC Name | 4-amino-1-(4-methylphenyl)piperidine-4-carboxylic acid;8-(4-methylphenyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | Cc1ccc(N2CCC(N)(C(=O)O)CC2)cc1.Cc1ccc(N2CCC3(CC2)NC(=O)NC3=O)cc1 |
| InChI | InChI=1S/C14H17N3O2.C13H18N2O2/c1-10-2-4-11(5-3-10)17-8-6-14(7-9-17)12(18)15-13(19)16-14;1-10-2-4-11(5-3-10)15-8-6-13(14,7-9-15)12(16)17/h2-5H,6-9H2,1H3,(H2,15,16,18,19);2-5H,6-9,14H2,1H3,(H,16,17) |
| InChIKey | SUGSXOAMGSICIP-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 128.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|