About CID 160941708
CID 160941708 (PubChem CID 160941708) has the molecular formula C48H54N10O7S6
and a molecular weight of 1075.42 g/mol.
Molecular Properties
| Compound Name | CID 160941708 |
| PubChem CID | 160941708 |
| Molecular Formula | C48H54N10O7S6 |
| Molecular Weight | 1075.42 g/mol |
| Exact Mass | 1074.25 |
| IUPAC Name | — |
| SMILES | CC(C)CCc1c2c(cc(=O)n1Cc1nc(-c3nc(C(=O)NCCN(C)C)cs3)cs1)C1(CC1)NC2=O.CC(C)CCc1c2c(cc(=O)n1Cc1nc(-c3nc(C(=O)O)cs3)cs1)C1(CC1)NC2=O.S=S |
| InChI | InChI=1S/C26H32N6O3S2.C22H22N4O4S2.S2/c1-15(2)5-6-19-22-16(26(7-8-26)30-24(22)35)11-21(33)32(19)12-20-28-18(14-36-20)25-29-17(13-37-25)23(34)27-9-10-31(3)4;1-11(2)3-4-15-18-12(22(5-6-22)25-19(18)28)7-17(27)26(15)8-16-23-13(9-31-16)20-24-14(10-32-20)21(29)30;1-2/h11,13-15H,5-10,12H2,1-4H3,(H,27,34)(H,30,35);7,9-11H,3-6,8H2,1-2H3,(H,25,28)(H,29,30); |
| InChIKey | SUPBKADCBICULE-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 223.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 71 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 1075.42 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 19 |
Analyze CID 160941708 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 160941708?
The IUPAC name of CID 160941708 (CID 160941708) is not available.
What is the SMILES notation for CID 160941708?
The canonical SMILES for CID 160941708 is CC(C)CCc1c2c(cc(=O)n1Cc1nc(-c3nc(C(=O)NCCN(C)C)cs3)cs1)C1(CC1)NC2=O.CC(C)CCc1c2c(cc(=O)n1Cc1nc(-c3nc(C(=O)O)cs3)cs1)C1(CC1)NC2=O.S=S.
What is the InChIKey of CID 160941708?
The InChIKey is SUPBKADCBICULE-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H32N6O3S2.C22H22N4O4S2.S2/c1-15(2)5-6-19-22-16(26(7-8-26)30-24(22)35)11-21(33)32(19)12-20-28-18(14-36-20)25-29-17(13-37-25)23(34)27-9-10-31(3)4;1-11(2)3-4-15-18-12(22(5-6-22)25-19(18)28)7-17(27)26(15)8-16-23-13(9-31-16)20-24-14(10-32-20)21(29)30;1-2/h11,13-15H,5-10,12H2,1-4H3,(H,27,34)(H,30,35);7,9-11H,3-6,8H2,1-2H3,(H,25,28)(H,29,30);.
What are the key properties of CID 160941708?
CID 160941708 has a molecular weight of 1075.42 g/mol, XLogP of 6.58, 17 rotatable bonds, 4 hydrogen bond donors, and 19 hydrogen bond acceptors.
Where does this data come from?
All data for CID 160941708 is sourced from PubChem (CID 160941708), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).