About bis(1H-indole);pyrrole-2,5-dione
bis(1H-indole);pyrrole-2,5-dione (PubChem CID 160942395) has the molecular formula C20H17N3O2
and a molecular weight of 331.38 g/mol. Its IUPAC name is bis(1H-indole);pyrrole-2,5-dione.
Molecular Properties
| Compound Name | bis(1H-indole);pyrrole-2,5-dione |
| PubChem CID | 160942395 |
| Molecular Formula | C20H17N3O2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | bis(1H-indole);pyrrole-2,5-dione |
| SMILES | O=C1C=CC(=O)N1.c1ccc2[nH]ccc2c1.c1ccc2[nH]ccc2c1 |
| InChI | InChI=1S/2C8H7N.C4H3NO2/c2*1-2-4-8-7(3-1)5-6-9-8;6-3-1-2-4(7)5-3/h2*1-6,9H;1-2H,(H,5,6,7) |
| InChIKey | SURBUIJTPHUHMS-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze bis(1H-indole);pyrrole-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1H-indole);pyrrole-2,5-dione?
The IUPAC name of bis(1H-indole);pyrrole-2,5-dione (CID 160942395) is bis(1H-indole);pyrrole-2,5-dione.
What is the SMILES notation for bis(1H-indole);pyrrole-2,5-dione?
The canonical SMILES for bis(1H-indole);pyrrole-2,5-dione is O=C1C=CC(=O)N1.c1ccc2[nH]ccc2c1.c1ccc2[nH]ccc2c1.
What is the InChIKey of bis(1H-indole);pyrrole-2,5-dione?
The InChIKey is SURBUIJTPHUHMS-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H7N.C4H3NO2/c2*1-2-4-8-7(3-1)5-6-9-8;6-3-1-2-4(7)5-3/h2*1-6,9H;1-2H,(H,5,6,7).
What are the key properties of bis(1H-indole);pyrrole-2,5-dione?
bis(1H-indole);pyrrole-2,5-dione has a molecular weight of 331.38 g/mol, XLogP of 3.53, 0 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1H-indole);pyrrole-2,5-dione is sourced from PubChem (CID 160942395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).