C22H35N3O2 — CID 160942801
4-[10-[(2R,3S,4S)-4-amino-3-hydroxypyrrolidin-2-yl]decoxymethyl]benzonitrile (PubChem CID 160942801) has the molecular formula C22H35N3O2 and a molecular weight of 373.54 g/mol. Its IUPAC name is 4-[10-[(2R,3S,4S)-4-amino-3-hydroxypyrrolidin-2-yl]decoxymethyl]benzonitrile.
| Compound Name | 4-[10-[(2R,3S,4S)-4-amino-3-hydroxypyrrolidin-2-yl]decoxymethyl]benzonitrile |
|---|---|
| PubChem CID | 160942801 |
| Molecular Formula | C22H35N3O2 |
| Molecular Weight | 373.54 g/mol |
| Exact Mass | 373.27 |
| IUPAC Name | 4-[10-[(2R,3S,4S)-4-amino-3-hydroxypyrrolidin-2-yl]decoxymethyl]benzonitrile |
| SMILES | N#Cc1ccc(COCCCCCCCCCC[C@H]2NC[C@H](N)[C@@H]2O)cc1 |
| InChI | InChI=1S/C22H35N3O2/c23-15-18-10-12-19(13-11-18)17-27-14-8-6-4-2-1-3-5-7-9-21-22(26)20(24)16-25-21/h10-13,20-22,25-26H,1-9,14,16-17,24H2/t20-,21+,22-/m0/s1 |
| InChIKey | SUSNESXAWWIQRE-BDTNDASRSA-N |
| XLogP | 3.25 |
| TPSA | 91.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.54 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|