C11H22BO4P — CID 160943298
[[(6R,8R,8aS)-2,6,7-trimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy-methylboranyl]phosphane (PubChem CID 160943298) has the molecular formula C11H22BO4P and a molecular weight of 260.08 g/mol. Its IUPAC name is [[(6R,8R,8aS)-2,6,7-trimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy-methylboranyl]phosphane.
| Compound Name | [[(6R,8R,8aS)-2,6,7-trimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy-methylboranyl]phosphane |
|---|---|
| PubChem CID | 160943298 |
| Molecular Formula | C11H22BO4P |
| Molecular Weight | 260.08 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | [[(6R,8R,8aS)-2,6,7-trimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl]oxy-methylboranyl]phosphane |
| SMILES | CB(P)O[C@@H]1C(C)[C@@H](C)OC2COC(C)O[C@H]21 |
| InChI | InChI=1S/C11H22BO4P/c1-6-7(2)14-9-5-13-8(3)15-11(9)10(6)16-12(4)17/h6-11H,5,17H2,1-4H3/t6?,7-,8?,9?,10-,11-/m1/s1 |
| InChIKey | PFMZBJCXQCRIOM-XDEUNEBJSA-N |
| XLogP | 1.55 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.08 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|