About 3-(4-fluorophenyl)-6,7-dihydro-5H-1-benzothiophen-4-one
3-(4-fluorophenyl)-6,7-dihydro-5H-1-benzothiophen-4-one (PubChem CID 160943711) has the molecular formula C14H11FOS
and a molecular weight of 246.31 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-6,7-dihydro-5H-1-benzothiophen-4-one.
Molecular Properties
| Compound Name | 3-(4-fluorophenyl)-6,7-dihydro-5H-1-benzothiophen-4-one |
| PubChem CID | 160943711 |
| Molecular Formula | C14H11FOS |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | 3-(4-fluorophenyl)-6,7-dihydro-5H-1-benzothiophen-4-one |
| SMILES | O=C1CCCc2scc(-c3ccc(F)cc3)c21 |
| InChI | InChI=1S/C14H11FOS/c15-10-6-4-9(5-7-10)11-8-17-13-3-1-2-12(16)14(11)13/h4-8H,1-3H2 |
| InChIKey | SUVKTGAHSHXBRM-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(4-fluorophenyl)-6,7-dihydro-5H-1-benzothiophen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-fluorophenyl)-6,7-dihydro-5H-1-benzothiophen-4-one?
The IUPAC name of 3-(4-fluorophenyl)-6,7-dihydro-5H-1-benzothiophen-4-one (CID 160943711) is 3-(4-fluorophenyl)-6,7-dihydro-5H-1-benzothiophen-4-one.
What is the SMILES notation for 3-(4-fluorophenyl)-6,7-dihydro-5H-1-benzothiophen-4-one?
The canonical SMILES for 3-(4-fluorophenyl)-6,7-dihydro-5H-1-benzothiophen-4-one is O=C1CCCc2scc(-c3ccc(F)cc3)c21.
What is the InChIKey of 3-(4-fluorophenyl)-6,7-dihydro-5H-1-benzothiophen-4-one?
The InChIKey is SUVKTGAHSHXBRM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11FOS/c15-10-6-4-9(5-7-10)11-8-17-13-3-1-2-12(16)14(11)13/h4-8H,1-3H2.
What are the key properties of 3-(4-fluorophenyl)-6,7-dihydro-5H-1-benzothiophen-4-one?
3-(4-fluorophenyl)-6,7-dihydro-5H-1-benzothiophen-4-one has a molecular weight of 246.31 g/mol, XLogP of 4.07, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-fluorophenyl)-6,7-dihydro-5H-1-benzothiophen-4-one is sourced from PubChem (CID 160943711), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).