C29H35NO2 — CID 160946733
1-[7-(hydroxymethyl)-9,9-bis(prop-2-enyl)fluoren-2-yl]-2-methyl-2-piperidin-1-ylpropan-1-one (PubChem CID 160946733) has the molecular formula C29H35NO2 and a molecular weight of 429.60 g/mol. Its IUPAC name is 1-[7-(hydroxymethyl)-9,9-bis(prop-2-enyl)fluoren-2-yl]-2-methyl-2-piperidin-1-ylpropan-1-one.
| Compound Name | 1-[7-(hydroxymethyl)-9,9-bis(prop-2-enyl)fluoren-2-yl]-2-methyl-2-piperidin-1-ylpropan-1-one |
|---|---|
| PubChem CID | 160946733 |
| Molecular Formula | C29H35NO2 |
| Molecular Weight | 429.60 g/mol |
| Exact Mass | 429.27 |
| IUPAC Name | 1-[7-(hydroxymethyl)-9,9-bis(prop-2-enyl)fluoren-2-yl]-2-methyl-2-piperidin-1-ylpropan-1-one |
| SMILES | C=CCC1(CC=C)c2cc(CO)ccc2-c2ccc(C(=O)C(C)(C)N3CCCCC3)cc21 |
| InChI | InChI=1S/C29H35NO2/c1-5-14-29(15-6-2)25-18-21(20-31)10-12-23(25)24-13-11-22(19-26(24)29)27(32)28(3,4)30-16-8-7-9-17-30/h5-6,10-13,18-19,31H,1-2,7-9,14-17,20H2,3-4H3 |
| InChIKey | YLXHVRISKBEHIN-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.60 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|