C13H7Br3F4O — CID 160948339
1-bromo-2,4-difluoro-5-methoxybenzene;1,5-dibromo-2,4-difluorobenzene (PubChem CID 160948339) has the molecular formula C13H7Br3F4O and a molecular weight of 494.90 g/mol. Its IUPAC name is 1-bromo-2,4-difluoro-5-methoxybenzene;1,5-dibromo-2,4-difluorobenzene.
| Compound Name | 1-bromo-2,4-difluoro-5-methoxybenzene;1,5-dibromo-2,4-difluorobenzene |
|---|---|
| PubChem CID | 160948339 |
| Molecular Formula | C13H7Br3F4O |
| Molecular Weight | 494.90 g/mol |
| Exact Mass | 491.80 |
| IUPAC Name | 1-bromo-2,4-difluoro-5-methoxybenzene;1,5-dibromo-2,4-difluorobenzene |
| SMILES | COc1cc(Br)c(F)cc1F.Fc1cc(F)c(Br)cc1Br |
| InChI | InChI=1S/C7H5BrF2O.C6H2Br2F2/c1-11-7-2-4(8)5(9)3-6(7)10;7-3-1-4(8)6(10)2-5(3)9/h2-3H,1H3;1-2H |
| InChIKey | SVKLRVIRXRPQTE-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.90 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|