C14H14FNO2 — CID 160949552
6-[(2E)-2-(fluoromethylidene)butoxy]-4H-isoquinolin-1-one (PubChem CID 160949552) has the molecular formula C14H14FNO2 and a molecular weight of 247.27 g/mol. Its IUPAC name is 6-[(2E)-2-(fluoromethylidene)butoxy]-4H-isoquinolin-1-one.
| Compound Name | 6-[(2E)-2-(fluoromethylidene)butoxy]-4H-isoquinolin-1-one |
|---|---|
| PubChem CID | 160949552 |
| Molecular Formula | C14H14FNO2 |
| Molecular Weight | 247.27 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 6-[(2E)-2-(fluoromethylidene)butoxy]-4H-isoquinolin-1-one |
| SMILES | CC/C(=C\F)COc1ccc2c(c1)CC=NC2=O |
| InChI | InChI=1S/C14H14FNO2/c1-2-10(8-15)9-18-12-3-4-13-11(7-12)5-6-16-14(13)17/h3-4,6-8H,2,5,9H2,1H3/b10-8+ |
| InChIKey | HXOHLCMJUCGSFD-CSKARUKUSA-N |
| XLogP | 3.10 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.27 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |