C41H27Cl5N6O6 — CID 160949893
2-(2-chloro-1H-indol-3-yl)acetamide;3-(2,6-dichloro-1H-indol-3-yl)-4-(1H-indol-3-yl)pyrrole-2,5-dione;methyl 2-(2,6-dichloro-1H-indol-3-yl)-2-oxoacetate (PubChem CID 160949893) has the molecular formula C41H27Cl5N6O6 and a molecular weight of 876.97 g/mol. Its IUPAC name is 2-(2-chloro-1H-indol-3-yl)acetamide;3-(2,6-dichloro-1H-indol-3-yl)-4-(1H-indol-3-yl)pyrrole-2,5-dione;methyl 2-(2,6-dichloro-1H-indol-3-yl)-2-oxoacetate.
| Compound Name | 2-(2-chloro-1H-indol-3-yl)acetamide;3-(2,6-dichloro-1H-indol-3-yl)-4-(1H-indol-3-yl)pyrrole-2,5-dione;methyl 2-(2,6-dichloro-1H-indol-3-yl)-2-oxoacetate |
|---|---|
| PubChem CID | 160949893 |
| Molecular Formula | C41H27Cl5N6O6 |
| Molecular Weight | 876.97 g/mol |
| Exact Mass | 874.04 |
| IUPAC Name | 2-(2-chloro-1H-indol-3-yl)acetamide;3-(2,6-dichloro-1H-indol-3-yl)-4-(1H-indol-3-yl)pyrrole-2,5-dione;methyl 2-(2,6-dichloro-1H-indol-3-yl)-2-oxoacetate |
| SMILES | COC(=O)C(=O)c1c(Cl)[nH]c2cc(Cl)ccc12.NC(=O)Cc1c(Cl)[nH]c2ccccc12.O=C1NC(=O)C(c2c(Cl)[nH]c3cc(Cl)ccc23)=C1c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C20H11Cl2N3O2.C11H7Cl2NO3.C10H9ClN2O/c21-9-5-6-11-14(7-9)24-18(22)15(11)17-16(19(26)25-20(17)27)12-8-23-13-4-2-1-3-10(12)13;1-17-11(16)9(15)8-6-3-2-5(12)4-7(6)14-10(8)13;11-10-7(5-9(12)14)6-3-1-2-4-8(6)13-10/h1-8,23-24H,(H,25,26,27);2-4,14H,1H3;1-4,13H,5H2,(H2,12,14) |
| InChIKey | SVPPOLKFAWSSRR-UHFFFAOYSA-N |
| XLogP | 9.20 |
| TPSA | 195.79 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 876.97 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|