C27H52S6 — CID 160950504
3,4-bis(methylsulfanyl)hexane;2,2-bis(methylsulfanyl)propane;1,4-bis(propylsulfanylmethyl)benzene (PubChem CID 160950504) has the molecular formula C27H52S6 and a molecular weight of 569.12 g/mol. Its IUPAC name is 3,4-bis(methylsulfanyl)hexane;2,2-bis(methylsulfanyl)propane;1,4-bis(propylsulfanylmethyl)benzene.
| Compound Name | 3,4-bis(methylsulfanyl)hexane;2,2-bis(methylsulfanyl)propane;1,4-bis(propylsulfanylmethyl)benzene |
|---|---|
| PubChem CID | 160950504 |
| Molecular Formula | C27H52S6 |
| Molecular Weight | 569.12 g/mol |
| Exact Mass | 568.24 |
| IUPAC Name | 3,4-bis(methylsulfanyl)hexane;2,2-bis(methylsulfanyl)propane;1,4-bis(propylsulfanylmethyl)benzene |
| SMILES | CCC(SC)C(CC)SC.CCCSCc1ccc(CSCCC)cc1.CSC(C)(C)SC |
| InChI | InChI=1S/C14H22S2.C8H18S2.C5H12S2/c1-3-9-15-11-13-5-7-14(8-6-13)12-16-10-4-2;1-5-7(9-3)8(6-2)10-4;1-5(2,6-3)7-4/h5-8H,3-4,9-12H2,1-2H3;7-8H,5-6H2,1-4H3;1-4H3 |
| InChIKey | SVRPXKMLBMJXEK-UHFFFAOYSA-N |
| XLogP | 10.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.12 |
| LogP ≤ 5 | 10.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|