C6H14ClNaO6 — CID 160950535
sodium;2-butoxyethanol;perchlorate (PubChem CID 160950535) has the molecular formula C6H14ClNaO6 and a molecular weight of 240.61 g/mol. Its IUPAC name is sodium;2-butoxyethanol;perchlorate.
| Compound Name | sodium;2-butoxyethanol;perchlorate |
|---|---|
| PubChem CID | 160950535 |
| Molecular Formula | C6H14ClNaO6 |
| Molecular Weight | 240.61 g/mol |
| Exact Mass | 240.04 |
| IUPAC Name | sodium;2-butoxyethanol;perchlorate |
| SMILES | CCCCOCCO.[Na+].[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C6H14O2.ClHO4.Na/c1-2-3-5-8-6-4-7;2-1(3,4)5;/h7H,2-6H2,1H3;(H,2,3,4,5);/q;;+1/p-1 |
| InChIKey | XXAFMJOZSCJHPS-UHFFFAOYSA-M |
| XLogP | -6.96 |
| TPSA | 121.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.61 |
| LogP ≤ 5 | -6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|