C20H26F3N4O5+ — CID 160951221
3-morpholin-4-ium-4-yl-N-(oxan-2-ylmethyl)-2H-imidazo[1,5-a]pyridin-4-ium-1-carboxamide;2,2,2-trifluoroacetate (PubChem CID 160951221) has the molecular formula C20H26F3N4O5+ and a molecular weight of 459.45 g/mol. Its IUPAC name is 3-morpholin-4-ium-4-yl-N-(oxan-2-ylmethyl)-2H-imidazo[1,5-a]pyridin-4-ium-1-carboxamide;2,2,2-trifluoroacetate.
| Compound Name | 3-morpholin-4-ium-4-yl-N-(oxan-2-ylmethyl)-2H-imidazo[1,5-a]pyridin-4-ium-1-carboxamide;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 160951221 |
| Molecular Formula | C20H26F3N4O5+ |
| Molecular Weight | 459.45 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | 3-morpholin-4-ium-4-yl-N-(oxan-2-ylmethyl)-2H-imidazo[1,5-a]pyridin-4-ium-1-carboxamide;2,2,2-trifluoroacetate |
| SMILES | O=C(NCC1CCCCO1)c1[nH]c([NH+]2CCOCC2)[n+]2ccccc12.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C18H24N4O3.C2HF3O2/c23-17(19-13-14-5-2-4-10-25-14)16-15-6-1-3-7-22(15)18(20-16)21-8-11-24-12-9-21;3-2(4,5)1(6)7/h1,3,6-7,14H,2,4-5,8-13H2,(H,19,23);(H,6,7)/p+1 |
| InChIKey | NBQKNVZIOLUEHB-UHFFFAOYSA-O |
| XLogP | -1.10 |
| TPSA | 112.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.45 |
| LogP ≤ 5 | -1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|