About 6-fluoro-4-[(1S,2R)-2-methoxycyclohexyl]quinoline
6-fluoro-4-[(1S,2R)-2-methoxycyclohexyl]quinoline (PubChem CID 160951324) has the molecular formula C16H18FNO
and a molecular weight of 259.32 g/mol. Its IUPAC name is 6-fluoro-4-[(1S,2R)-2-methoxycyclohexyl]quinoline.
Molecular Properties
| Compound Name | 6-fluoro-4-[(1S,2R)-2-methoxycyclohexyl]quinoline |
| PubChem CID | 160951324 |
| Molecular Formula | C16H18FNO |
| Molecular Weight | 259.32 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 6-fluoro-4-[(1S,2R)-2-methoxycyclohexyl]quinoline |
| SMILES | CO[C@@H]1CCCC[C@H]1c1ccnc2ccc(F)cc12 |
| InChI | InChI=1S/C16H18FNO/c1-19-16-5-3-2-4-13(16)12-8-9-18-15-7-6-11(17)10-14(12)15/h6-10,13,16H,2-5H2,1H3/t13-,16+/m0/s1 |
| InChIKey | IWDNKKZFCCBVQE-XJKSGUPXSA-N |
| XLogP | 4.05 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.32 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-fluoro-4-[(1S,2R)-2-methoxycyclohexyl]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-4-[(1S,2R)-2-methoxycyclohexyl]quinoline?
The IUPAC name of 6-fluoro-4-[(1S,2R)-2-methoxycyclohexyl]quinoline (CID 160951324) is 6-fluoro-4-[(1S,2R)-2-methoxycyclohexyl]quinoline.
What is the SMILES notation for 6-fluoro-4-[(1S,2R)-2-methoxycyclohexyl]quinoline?
The canonical SMILES for 6-fluoro-4-[(1S,2R)-2-methoxycyclohexyl]quinoline is CO[C@@H]1CCCC[C@H]1c1ccnc2ccc(F)cc12.
What is the InChIKey of 6-fluoro-4-[(1S,2R)-2-methoxycyclohexyl]quinoline?
The InChIKey is IWDNKKZFCCBVQE-XJKSGUPXSA-N. The full InChI is InChI=1S/C16H18FNO/c1-19-16-5-3-2-4-13(16)12-8-9-18-15-7-6-11(17)10-14(12)15/h6-10,13,16H,2-5H2,1H3/t13-,16+/m0/s1.
What are the key properties of 6-fluoro-4-[(1S,2R)-2-methoxycyclohexyl]quinoline?
6-fluoro-4-[(1S,2R)-2-methoxycyclohexyl]quinoline has a molecular weight of 259.32 g/mol, XLogP of 4.05, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-4-[(1S,2R)-2-methoxycyclohexyl]quinoline is sourced from PubChem (CID 160951324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).