C32H32FN5O4S — CID 160951406
4-[3-fluoro-4-[2-[5-[(2-methoxyethylamino)methyl]-1-methylimidazol-2-yl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]-N-methyl-3-oxo-N-phenylbutanamide (PubChem CID 160951406) has the molecular formula C32H32FN5O4S and a molecular weight of 601.70 g/mol. Its IUPAC name is 4-[3-fluoro-4-[2-[5-[(2-methoxyethylamino)methyl]-1-methylimidazol-2-yl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]-N-methyl-3-oxo-N-phenylbutanamide.
| Compound Name | 4-[3-fluoro-4-[2-[5-[(2-methoxyethylamino)methyl]-1-methylimidazol-2-yl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]-N-methyl-3-oxo-N-phenylbutanamide |
|---|---|
| PubChem CID | 160951406 |
| Molecular Formula | C32H32FN5O4S |
| Molecular Weight | 601.70 g/mol |
| Exact Mass | 601.22 |
| IUPAC Name | 4-[3-fluoro-4-[2-[5-[(2-methoxyethylamino)methyl]-1-methylimidazol-2-yl]thieno[3,2-b]pyridin-7-yl]oxyphenyl]-N-methyl-3-oxo-N-phenylbutanamide |
| SMILES | COCCNCc1cnc(-c2cc3nccc(Oc4ccc(CC(=O)CC(=O)N(C)c5ccccc5)cc4F)c3s2)n1C |
| InChI | InChI=1S/C32H32FN5O4S/c1-37(22-7-5-4-6-8-22)30(40)17-24(39)15-21-9-10-27(25(33)16-21)42-28-11-12-35-26-18-29(43-31(26)28)32-36-20-23(38(32)2)19-34-13-14-41-3/h4-12,16,18,20,34H,13-15,17,19H2,1-3H3 |
| InChIKey | SVURVUBXLKYLSM-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 98.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.70 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|