About CID 160951591
CID 160951591 (PubChem CID 160951591) has the molecular formula C5H10N2Sb
and a molecular weight of 219.91 g/mol.
Molecular Properties
| Compound Name | CID 160951591 |
| PubChem CID | 160951591 |
| Molecular Formula | C5H10N2Sb |
| Molecular Weight | 219.91 g/mol |
| Exact Mass | 218.99 |
| IUPAC Name | — |
| SMILES | CC(=C[SbH])C(C)=NN |
| InChI | InChI=1S/C5H9N2.Sb.H/c1-4(2)5(3)7-6;;/h1H,6H2,2-3H3;; |
| InChIKey | RUBKHLFQPZNZOY-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.91 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 160951591 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 160951591?
The IUPAC name of CID 160951591 (CID 160951591) is not available.
What is the SMILES notation for CID 160951591?
The canonical SMILES for CID 160951591 is CC(=C[SbH])C(C)=NN.
What is the InChIKey of CID 160951591?
The InChIKey is RUBKHLFQPZNZOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N2.Sb.H/c1-4(2)5(3)7-6;;/h1H,6H2,2-3H3;;.
What are the key properties of CID 160951591?
CID 160951591 has a molecular weight of 219.91 g/mol, XLogP of 0.13, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 160951591 is sourced from PubChem (CID 160951591), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).