About 8-chloro-2-(2-chlorophenyl)-3-methoxyquinoline;2,8-dichloro-3-methoxyquinoline
8-chloro-2-(2-chlorophenyl)-3-methoxyquinoline;2,8-dichloro-3-methoxyquinoline (PubChem CID 160951827) has the molecular formula C26H18Cl4N2O2
and a molecular weight of 532.25 g/mol. Its IUPAC name is 8-chloro-2-(2-chlorophenyl)-3-methoxyquinoline;2,8-dichloro-3-methoxyquinoline.
Molecular Properties
| Compound Name | 8-chloro-2-(2-chlorophenyl)-3-methoxyquinoline;2,8-dichloro-3-methoxyquinoline |
| PubChem CID | 160951827 |
| Molecular Formula | C26H18Cl4N2O2 |
| Molecular Weight | 532.25 g/mol |
| Exact Mass | 530.01 |
| IUPAC Name | 8-chloro-2-(2-chlorophenyl)-3-methoxyquinoline;2,8-dichloro-3-methoxyquinoline |
| SMILES | COc1cc2cccc(Cl)c2nc1-c1ccccc1Cl.COc1cc2cccc(Cl)c2nc1Cl |
| InChI | InChI=1S/C16H11Cl2NO.C10H7Cl2NO/c1-20-14-9-10-5-4-8-13(18)15(10)19-16(14)11-6-2-3-7-12(11)17;1-14-8-5-6-3-2-4-7(11)9(6)13-10(8)12/h2-9H,1H3;2-5H,1H3 |
| InChIKey | SVWAKQYJBJABGC-UHFFFAOYSA-N |
| XLogP | 8.77 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 532.25 |
| LogP ≤ 5 | 8.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 8-chloro-2-(2-chlorophenyl)-3-methoxyquinoline;2,8-dichloro-3-methoxyquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-2-(2-chlorophenyl)-3-methoxyquinoline;2,8-dichloro-3-methoxyquinoline?
The IUPAC name of 8-chloro-2-(2-chlorophenyl)-3-methoxyquinoline;2,8-dichloro-3-methoxyquinoline (CID 160951827) is 8-chloro-2-(2-chlorophenyl)-3-methoxyquinoline;2,8-dichloro-3-methoxyquinoline.
What is the SMILES notation for 8-chloro-2-(2-chlorophenyl)-3-methoxyquinoline;2,8-dichloro-3-methoxyquinoline?
The canonical SMILES for 8-chloro-2-(2-chlorophenyl)-3-methoxyquinoline;2,8-dichloro-3-methoxyquinoline is COc1cc2cccc(Cl)c2nc1-c1ccccc1Cl.COc1cc2cccc(Cl)c2nc1Cl.
What is the InChIKey of 8-chloro-2-(2-chlorophenyl)-3-methoxyquinoline;2,8-dichloro-3-methoxyquinoline?
The InChIKey is SVWAKQYJBJABGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11Cl2NO.C10H7Cl2NO/c1-20-14-9-10-5-4-8-13(18)15(10)19-16(14)11-6-2-3-7-12(11)17;1-14-8-5-6-3-2-4-7(11)9(6)13-10(8)12/h2-9H,1H3;2-5H,1H3.
What are the key properties of 8-chloro-2-(2-chlorophenyl)-3-methoxyquinoline;2,8-dichloro-3-methoxyquinoline?
8-chloro-2-(2-chlorophenyl)-3-methoxyquinoline;2,8-dichloro-3-methoxyquinoline has a molecular weight of 532.25 g/mol, XLogP of 8.77, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-2-(2-chlorophenyl)-3-methoxyquinoline;2,8-dichloro-3-methoxyquinoline is sourced from PubChem (CID 160951827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).