C23H49N2O4S3Si+ — CID 160953656
[5-amino-4-[3-[dimethyl(propan-2-yloxy)silyl]propylsulfanylcarbothioylsulfanyl]-1-hydroxy-2,4-dimethyl-5-oxo-2-propylpentoxy]methyl-trimethylazanium (PubChem CID 160953656) has the molecular formula C23H49N2O4S3Si+ and a molecular weight of 541.94 g/mol. Its IUPAC name is [5-amino-4-[3-[dimethyl(propan-2-yloxy)silyl]propylsulfanylcarbothioylsulfanyl]-1-hydroxy-2,4-dimethyl-5-oxo-2-propylpentoxy]methyl-trimethylazanium.
| Compound Name | [5-amino-4-[3-[dimethyl(propan-2-yloxy)silyl]propylsulfanylcarbothioylsulfanyl]-1-hydroxy-2,4-dimethyl-5-oxo-2-propylpentoxy]methyl-trimethylazanium |
|---|---|
| PubChem CID | 160953656 |
| Molecular Formula | C23H49N2O4S3Si+ |
| Molecular Weight | 541.94 g/mol |
| Exact Mass | 541.26 |
| IUPAC Name | [5-amino-4-[3-[dimethyl(propan-2-yloxy)silyl]propylsulfanylcarbothioylsulfanyl]-1-hydroxy-2,4-dimethyl-5-oxo-2-propylpentoxy]methyl-trimethylazanium |
| SMILES | CCCC(C)(CC(C)(SC(=S)SCCC[Si](C)(C)OC(C)C)C(N)=O)C(O)OC[N+](C)(C)C |
| InChI | InChI=1S/C23H48N2O4S3Si/c1-11-13-22(4,20(27)28-17-25(6,7)8)16-23(5,19(24)26)32-21(30)31-14-12-15-33(9,10)29-18(2)3/h18,20,27H,11-17H2,1-10H3,(H-,24,26)/p+1 |
| InChIKey | HKLNXWKSJKGOCS-UHFFFAOYSA-O |
| XLogP | 5.20 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.94 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|