C43H40N4O8 — CID 160955283
2-benzoyl-N-hydroxy-1,3-dihydroisoindole-4-carboxamide;methyl 2-benzoyl-1,3-dihydroisoindole-4-carboxylate;methyl 2,3-dihydro-1H-isoindole-4-carboxylate (PubChem CID 160955283) has the molecular formula C43H40N4O8 and a molecular weight of 740.81 g/mol. Its IUPAC name is 2-benzoyl-N-hydroxy-1,3-dihydroisoindole-4-carboxamide;methyl 2-benzoyl-1,3-dihydroisoindole-4-carboxylate;methyl 2,3-dihydro-1H-isoindole-4-carboxylate.
| Compound Name | 2-benzoyl-N-hydroxy-1,3-dihydroisoindole-4-carboxamide;methyl 2-benzoyl-1,3-dihydroisoindole-4-carboxylate;methyl 2,3-dihydro-1H-isoindole-4-carboxylate |
|---|---|
| PubChem CID | 160955283 |
| Molecular Formula | C43H40N4O8 |
| Molecular Weight | 740.81 g/mol |
| Exact Mass | 740.28 |
| IUPAC Name | 2-benzoyl-N-hydroxy-1,3-dihydroisoindole-4-carboxamide;methyl 2-benzoyl-1,3-dihydroisoindole-4-carboxylate;methyl 2,3-dihydro-1H-isoindole-4-carboxylate |
| SMILES | COC(=O)c1cccc2c1CN(C(=O)c1ccccc1)C2.COC(=O)c1cccc2c1CNC2.O=C(NO)c1cccc2c1CN(C(=O)c1ccccc1)C2 |
| InChI | InChI=1S/C17H15NO3.C16H14N2O3.C10H11NO2/c1-21-17(20)14-9-5-8-13-10-18(11-15(13)14)16(19)12-6-3-2-4-7-12;19-15(17-21)13-8-4-7-12-9-18(10-14(12)13)16(20)11-5-2-1-3-6-11;1-13-10(12)8-4-2-3-7-5-11-6-9(7)8/h2-9H,10-11H2,1H3;1-8,21H,9-10H2,(H,17,19);2-4,11H,5-6H2,1H3 |
| InChIKey | SWHNIIDTSMJQOC-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 154.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.81 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|