C40H72O6Se2 — CID 160955322
3,3-dihexyl-2,4-dihydroselenopheno[3,4-b][1,4]dioxepine;2,2-dihexylpropane-1,3-diol;(4-methoxyselenophen-3-yl)methanol (PubChem CID 160955322) has the molecular formula C40H72O6Se2 and a molecular weight of 806.93 g/mol. Its IUPAC name is 3,3-dihexyl-2,4-dihydroselenopheno[3,4-b][1,4]dioxepine;2,2-dihexylpropane-1,3-diol;(4-methoxyselenophen-3-yl)methanol.
| Compound Name | 3,3-dihexyl-2,4-dihydroselenopheno[3,4-b][1,4]dioxepine;2,2-dihexylpropane-1,3-diol;(4-methoxyselenophen-3-yl)methanol |
|---|---|
| PubChem CID | 160955322 |
| Molecular Formula | C40H72O6Se2 |
| Molecular Weight | 806.93 g/mol |
| Exact Mass | 808.37 |
| IUPAC Name | 3,3-dihexyl-2,4-dihydroselenopheno[3,4-b][1,4]dioxepine;2,2-dihexylpropane-1,3-diol;(4-methoxyselenophen-3-yl)methanol |
| SMILES | CCCCCCC(CO)(CO)CCCCCC.CCCCCCC1(CCCCCC)COc2c[se]cc2OC1.COc1c[se]cc1CO |
| InChI | InChI=1S/C19H32O2Se.C15H32O2.C6H8O2Se/c1-3-5-7-9-11-19(12-10-8-6-4-2)15-20-17-13-22-14-18(17)21-16-19;1-3-5-7-9-11-15(13-16,14-17)12-10-8-6-4-2;1-8-6-4-9-3-5(6)2-7/h13-14H,3-12,15-16H2,1-2H3;16-17H,3-14H2,1-2H3;3-4,7H,2H2,1H3 |
| InChIKey | SWHQFWVCQKYDMO-UHFFFAOYSA-N |
| XLogP | 9.58 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 806.93 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|