C26H35N3O5 — CID 160955771
benzene-1,4-diamine;3-methyl-1-[4-(3-methyl-2-oxobutyl)phenyl]butan-2-one;4-methyl-1,3-oxazolidine-2,5-dione (PubChem CID 160955771) has the molecular formula C26H35N3O5 and a molecular weight of 469.58 g/mol. Its IUPAC name is benzene-1,4-diamine;3-methyl-1-[4-(3-methyl-2-oxobutyl)phenyl]butan-2-one;4-methyl-1,3-oxazolidine-2,5-dione.
| Compound Name | benzene-1,4-diamine;3-methyl-1-[4-(3-methyl-2-oxobutyl)phenyl]butan-2-one;4-methyl-1,3-oxazolidine-2,5-dione |
|---|---|
| PubChem CID | 160955771 |
| Molecular Formula | C26H35N3O5 |
| Molecular Weight | 469.58 g/mol |
| Exact Mass | 469.26 |
| IUPAC Name | benzene-1,4-diamine;3-methyl-1-[4-(3-methyl-2-oxobutyl)phenyl]butan-2-one;4-methyl-1,3-oxazolidine-2,5-dione |
| SMILES | CC(C)C(=O)Cc1ccc(CC(=O)C(C)C)cc1.CC1NC(=O)OC1=O.Nc1ccc(N)cc1 |
| InChI | InChI=1S/C16H22O2.C6H8N2.C4H5NO3/c1-11(2)15(17)9-13-5-7-14(8-6-13)10-16(18)12(3)4;7-5-1-2-6(8)4-3-5;1-2-3(6)8-4(7)5-2/h5-8,11-12H,9-10H2,1-4H3;1-4H,7-8H2;2H,1H3,(H,5,7) |
| InChIKey | SWJCIGLGLQCTOF-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 141.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.58 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|