C37H34N10O7S2 — CID 160955846
methanol;bis(1-(2-methyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)-2-(3-nitro-6-thiophen-2-yl-2-pyridinyl)ethanone) (PubChem CID 160955846) has the molecular formula C37H34N10O7S2 and a molecular weight of 794.88 g/mol. Its IUPAC name is methanol;bis(1-(2-methyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)-2-(3-nitro-6-thiophen-2-yl-2-pyridinyl)ethanone).
| Compound Name | methanol;bis(1-(2-methyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)-2-(3-nitro-6-thiophen-2-yl-2-pyridinyl)ethanone) |
|---|---|
| PubChem CID | 160955846 |
| Molecular Formula | C37H34N10O7S2 |
| Molecular Weight | 794.88 g/mol |
| Exact Mass | 794.21 |
| IUPAC Name | methanol;bis(1-(2-methyl-5,7-dihydropyrrolo[3,4-d]pyrimidin-6-yl)-2-(3-nitro-6-thiophen-2-yl-2-pyridinyl)ethanone) |
| SMILES | CO.Cc1ncc2c(n1)CN(C(=O)Cc1nc(-c3cccs3)ccc1[N+](=O)[O-])C2.Cc1ncc2c(n1)CN(C(=O)Cc1nc(-c3cccs3)ccc1[N+](=O)[O-])C2 |
| InChI | InChI=1S/2C18H15N5O3S.CH4O/c2*1-11-19-8-12-9-22(10-15(12)20-11)18(24)7-14-16(23(25)26)5-4-13(21-14)17-3-2-6-27-17;1-2/h2*2-6,8H,7,9-10H2,1H3;2H,1H3 |
| InChIKey | SWJJSIQZUQOQTB-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 224.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.88 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|